import { AnimatePresence, DeprecatedLayoutGroupContext, DragControls, FlatTree, LayoutGroup, LazyMotion, MotionConfig, MotionConfigContext, MotionContext, MotionValue, PresenceContext, Reorder, SwitchLayoutGroupContext, VisualElement, __commonJS, __privateAdd, __privateGet, __privateSet, __toESM, addPointerEvent, addPointerInfo, addScaleCorrector, animate, animateValue, animateVisualElement, animationControls, animations, anticipate, backIn, backInOut, backOut, buildTransform, calcLength, checkTargetForNewValues, circIn, circInOut, circOut, clamp, color, complex, createBox, createDomMotionComponent, createMotionComponent, createScopedAnimate, cubicBezier, delay, distance, distance2D, domAnimation, domMax, easeIn, easeInOut, easeOut, filterProps, frameData, inView, interpolate, invariant, isBrowser, isDragActive, isMotionComponent, isMotionValue, isValidMotionProp, m, makeUseVisualState, mirrorEasing, mix, motion, motionValue, optimizedAppearDataAttribute, pipe, progress, px, resolveMotionValue, reverseEasing, scroll, spring, stagger, startOptimizedAppearAnimation, sync, transform, unwrapMotionComponent, useAnimate, useAnimatedState, useAnimation, useAnimationControls, useAnimationFrame, useCycle, useDomEvent, useDragControls, useElementScroll, useForceUpdate, useInView, useInstantLayoutTransition, useInstantTransition, useInvertedScale, useIsPresent, useIsomorphicLayoutEffect, useMotionTemplate, useMotionValue, useMotionValueEvent, usePresence, useReducedMotion, useReducedMotionConfig, useResetProjection, useScroll, useSpring, useTime, useTransform, useUnmountEffect, useVelocity, useViewportScroll, useWillChange, warning, wrap } from "./chunk-AVQ3R5VZ.js"; // ../../../node_modules/hsluv/hsluv.js var require_hsluv = __commonJS({ "../../../node_modules/hsluv/hsluv.js"(exports, module) { var hsluv = hsluv || {}; hsluv.Geometry = function() { }; hsluv.Geometry.intersectLineLine = function(a, b) { var x = (a.intercept - b.intercept) / (b.slope - a.slope); var y = a.slope * x + a.intercept; return { x, y }; }; hsluv.Geometry.distanceFromOrigin = function(point) { return Math.sqrt(Math.pow(point.x, 2) + Math.pow(point.y, 2)); }; hsluv.Geometry.distanceLineFromOrigin = function(line) { return Math.abs(line.intercept) / Math.sqrt(Math.pow(line.slope, 2) + 1); }; hsluv.Geometry.perpendicularThroughPoint = function(line, point) { var slope = -1 / line.slope; var intercept = point.y - slope * point.x; return { slope, intercept }; }; hsluv.Geometry.angleFromOrigin = function(point) { return Math.atan2(point.y, point.x); }; hsluv.Geometry.normalizeAngle = function(angle) { var m2 = 2 * Math.PI; return (angle % m2 + m2) % m2; }; hsluv.Geometry.lengthOfRayUntilIntersect = function(theta, line) { return line.intercept / (Math.sin(theta) - line.slope * Math.cos(theta)); }; hsluv.Hsluv = function() { }; hsluv.Hsluv.getBounds = function(L) { var result = []; var sub1 = Math.pow(L + 16, 3) / 1560896; var sub2 = sub1 > hsluv.Hsluv.epsilon ? sub1 : L / hsluv.Hsluv.kappa; var _g = 0; while (_g < 3) { var c=_ g++; var m1=h sluv.Hsluv.m[c][0]; var m2=h sluv.Hsluv.m[c][1]; var m3=h sluv.Hsluv.m[c][2]; var _g1=0 ; while (_g1 < 2) { var t=_ g1++; var top1=( 284517 * m1 - 94839 * m3) * sub2; var top2=( 838422 * m3 + 769860 * m2 + 731718 * m1) * L * sub2 - 769860 * t * L; var bottom=( 632260 * m3 - 126452 * m2) * sub2 + 126452 * t; result.push({ slope: top1 / bottom, intercept: top2 / bottom }); } } return result; }; hsluv.Hsluv.maxSafeChromaForL=f unction(L) { var bounds=h sluv.Hsluv.getBounds(L); var min=I nfinity; var _g=0 ; while (_g < bounds.length) { var bound=b ounds[_g]; ++_g; var length=h sluv.Geometry.distanceLineFromOrigin(bound); min=M ath.min(min, length); } return min; }; hsluv.Hsluv.maxChromaForLH=f unction(L, H) { var hrad=H / 360 * Math.PI * 2; var bounds=h sluv.Hsluv.getBounds(L); var min=I nfinity; var _g=0 ; while (_g < bounds.length) { var bound=b ounds[_g]; ++_g; var length=h sluv.Geometry.lengthOfRayUntilIntersect(hrad, bound); if (length>= 0) { min = Math.min(min, length); } } return min; }; hsluv.Hsluv.dotProduct = function(a, b) { var sum = 0; var _g1 = 0; var _g = a.length; while (_g1 < _g) { var i=_ g1++; sum +=a [i] * b[i]; } return sum; }; hsluv.Hsluv.fromLinear=f unction(c) { if (c <=3 1308e-7) { return 12.92 * c; } else { return 1.055 * Math.pow(c, 0.4166666666666667) - 0.055; } }; hsluv.Hsluv.toLinear=f unction(c) { if (c> 0.04045) { return Math.pow((c + 0.055) / 1.055, 2.4); } else { return c / 12.92; } }; hsluv.Hsluv.xyzToRgb = function(tuple) { return [hsluv.Hsluv.fromLinear(hsluv.Hsluv.dotProduct(hsluv.Hsluv.m[0], tuple)), hsluv.Hsluv.fromLinear(hsluv.Hsluv.dotProduct(hsluv.Hsluv.m[1], tuple)), hsluv.Hsluv.fromLinear(hsluv.Hsluv.dotProduct(hsluv.Hsluv.m[2], tuple))]; }; hsluv.Hsluv.rgbToXyz = function(tuple) { var rgbl = [hsluv.Hsluv.toLinear(tuple[0]), hsluv.Hsluv.toLinear(tuple[1]), hsluv.Hsluv.toLinear(tuple[2])]; return [hsluv.Hsluv.dotProduct(hsluv.Hsluv.minv[0], rgbl), hsluv.Hsluv.dotProduct(hsluv.Hsluv.minv[1], rgbl), hsluv.Hsluv.dotProduct(hsluv.Hsluv.minv[2], rgbl)]; }; hsluv.Hsluv.yToL = function(Y) { if (Y <=h sluv.Hsluv.epsilon) { return Y / hsluv.Hsluv.refY * hsluv.Hsluv.kappa; } else { return 116 * Math.pow(Y / hsluv.Hsluv.refY, 0.3333333333333333) - 16; } }; hsluv.Hsluv.lToY=f unction(L) { if (L <=8 ) { return hsluv.Hsluv.refY * L / hsluv.Hsluv.kappa; } else { return hsluv.Hsluv.refY * Math.pow((L + 16) / 116, 3); } }; hsluv.Hsluv.xyzToLuv=f unction(tuple) { var X=t uple[0]; var Y=t uple[1]; var Z=t uple[2]; var divider=X + 15 * Y + 3 * Z; var varU=4 * X; var varV=9 * Y; if (divider !=0 ) { varU /=d ivider; varV /=d ivider; } else { varU=N aN; varV=N aN; } var L=h sluv.Hsluv.yToL(Y); if (L==0 ) { return [0, 0, 0]; } var U=1 3 * L * (varU - hsluv.Hsluv.refU); var V=1 3 * L * (varV - hsluv.Hsluv.refV); return [L, U, V]; }; hsluv.Hsluv.luvToXyz=f unction(tuple) { var L=t uple[0]; var U=t uple[1]; var V=t uple[2]; if (L==0 ) { return [0, 0, 0]; } var varU=U / (13 * L) + hsluv.Hsluv.refU; var varV=V / (13 * L) + hsluv.Hsluv.refV; var Y=h sluv.Hsluv.lToY(L); var X=0 - 9 * Y * varU / ((varU - 4) * varV - varU * varV); var Z=( 9 * Y - 15 * varV * Y - varV * X) / (3 * varV); return [X, Y, Z]; }; hsluv.Hsluv.luvToLch=f unction(tuple) { var L=t uple[0]; var U=t uple[1]; var V=t uple[2]; var C=M ath.sqrt(U * U + V * V); var H; if (C < 1e-8) { H=0 ; } else { var Hrad=M ath.atan2(V, U); H=H rad * 180 / Math.PI; if (H < 0) { H=3 60 + H; } } return [L, C, H]; }; hsluv.Hsluv.lchToLuv=f unction(tuple) { var L=t uple[0]; var C=t uple[1]; var H=t uple[2]; var Hrad=H / 360 * 2 * Math.PI; var U=M ath.cos(Hrad) * C; var V=M ath.sin(Hrad) * C; return [L, U, V]; }; hsluv.Hsluv.hsluvToLch=f unction(tuple) { var H=t uple[0]; var S=t uple[1]; var L=t uple[2]; if (L> 99.9999999) { return [100, 0, H]; } if (L < 1e-8) { return [0, 0, H]; } var max=h sluv.Hsluv.maxChromaForLH(L, H); var C=m ax / 100 * S; return [L, C, H]; }; hsluv.Hsluv.lchToHsluv=f unction(tuple) { var L=t uple[0]; var C=t uple[1]; var H=t uple[2]; if (L> 99.9999999) { return [H, 0, 100]; } if (L < 1e-8) { return [H, 0, 0]; } var max=h sluv.Hsluv.maxChromaForLH(L, H); var S=C / max * 100; return [H, S, L]; }; hsluv.Hsluv.hpluvToLch=f unction(tuple) { var H=t uple[0]; var S=t uple[1]; var L=t uple[2]; if (L> 99.9999999) { return [100, 0, H]; } if (L < 1e-8) { return [0, 0, H]; } var max=h sluv.Hsluv.maxSafeChromaForL(L); var C=m ax / 100 * S; return [L, C, H]; }; hsluv.Hsluv.lchToHpluv=f unction(tuple) { var L=t uple[0]; var C=t uple[1]; var H=t uple[2]; if (L> 99.9999999) { return [H, 0, 100]; } if (L < 1e-8) { return [H, 0, 0]; } var max=h sluv.Hsluv.maxSafeChromaForL(L); var S=C / max * 100; return [H, S, L]; }; hsluv.Hsluv.rgbToHex=f unction(tuple) { var h="#" ; var _g=0 ; while (_g < 3) { var i=_ g++; var chan=t uple[i]; var c=M ath.round(chan * 255); var digit2=c % 16; var digit1=( c - digit2) / 16 | 0; h +=h sluv.Hsluv.hexChars.charAt(digit1) + hsluv.Hsluv.hexChars.charAt(digit2); } return h; }; hsluv.Hsluv.hexToRgb=f unction(hex) { hex=h ex.toLowerCase(); var ret=[ ]; var _g=0 ; while (_g < 3) { var i=_ g++; var digit1=h sluv.Hsluv.hexChars.indexOf(hex.charAt(i * 2 + 1)); var digit2=h sluv.Hsluv.hexChars.indexOf(hex.charAt(i * 2 + 2)); var n=d igit1 * 16 + digit2; ret.push(n / 255); } return ret; }; hsluv.Hsluv.lchToRgb=f unction(tuple) { return hsluv.Hsluv.xyzToRgb(hsluv.Hsluv.luvToXyz(hsluv.Hsluv.lchToLuv(tuple))); }; hsluv.Hsluv.rgbToLch=f unction(tuple) { return hsluv.Hsluv.luvToLch(hsluv.Hsluv.xyzToLuv(hsluv.Hsluv.rgbToXyz(tuple))); }; hsluv.Hsluv.hsluvToRgb=f unction(tuple) { return hsluv.Hsluv.lchToRgb(hsluv.Hsluv.hsluvToLch(tuple)); }; hsluv.Hsluv.rgbToHsluv=f unction(tuple) { return hsluv.Hsluv.lchToHsluv(hsluv.Hsluv.rgbToLch(tuple)); }; hsluv.Hsluv.hpluvToRgb=f unction(tuple) { return hsluv.Hsluv.lchToRgb(hsluv.Hsluv.hpluvToLch(tuple)); }; hsluv.Hsluv.rgbToHpluv=f unction(tuple) { return hsluv.Hsluv.lchToHpluv(hsluv.Hsluv.rgbToLch(tuple)); }; hsluv.Hsluv.hsluvToHex=f unction(tuple) { return hsluv.Hsluv.rgbToHex(hsluv.Hsluv.hsluvToRgb(tuple)); }; hsluv.Hsluv.hpluvToHex=f unction(tuple) { return hsluv.Hsluv.rgbToHex(hsluv.Hsluv.hpluvToRgb(tuple)); }; hsluv.Hsluv.hexToHsluv=f unction(s) { return hsluv.Hsluv.rgbToHsluv(hsluv.Hsluv.hexToRgb(s)); }; hsluv.Hsluv.hexToHpluv=f unction(s) { return hsluv.Hsluv.rgbToHpluv(hsluv.Hsluv.hexToRgb(s)); }; hsluv.Hsluv.m=[ [3.240969941904521, -1.537383177570093, -0.498610760293], [-0.96924363628087, 1.87596750150772, 0.041555057407175], [0.055630079696993, -0.20397695888897, 1.056971514242878]]; hsluv.Hsluv.minv=[ [0.41239079926595, 0.35758433938387, 0.18048078840183], [0.21263900587151, 0.71516867876775, 0.072192315360733], [0.019330818715591, 0.11919477979462, 0.95053215224966]]; hsluv.Hsluv.refY=1 ; hsluv.Hsluv.refU=0 .19783000664283; hsluv.Hsluv.refV=0 .46831999493879; hsluv.Hsluv.kappa=9 03.2962962; hsluv.Hsluv.epsilon=0 .0088564516; hsluv.Hsluv.hexChars="0123456789abcdef" ; var root={ "hsluvToRgb": hsluv.Hsluv.hsluvToRgb, "rgbToHsluv": hsluv.Hsluv.rgbToHsluv, "hpluvToRgb": hsluv.Hsluv.hpluvToRgb, "rgbToHpluv": hsluv.Hsluv.rgbToHpluv, "hsluvToHex": hsluv.Hsluv.hsluvToHex, "hexToHsluv": hsluv.Hsluv.hexToHsluv, "hpluvToHex": hsluv.Hsluv.hpluvToHex, "hexToHpluv": hsluv.Hsluv.hexToHpluv, "lchToHpluv": hsluv.Hsluv.lchToHpluv, "hpluvToLch": hsluv.Hsluv.hpluvToLch, "lchToHsluv": hsluv.Hsluv.lchToHsluv, "hsluvToLch": hsluv.Hsluv.hsluvToLch, "lchToLuv": hsluv.Hsluv.lchToLuv, "luvToLch": hsluv.Hsluv.luvToLch, "xyzToLuv": hsluv.Hsluv.xyzToLuv, "luvToXyz": hsluv.Hsluv.luvToXyz, "xyzToRgb": hsluv.Hsluv.xyzToRgb, "rgbToXyz": hsluv.Hsluv.rgbToXyz, "lchToRgb": hsluv.Hsluv.lchToRgb, "rgbToLch": hsluv.Hsluv.rgbToLch }; module.exports=r oot; } }); // ../../../node_modules/eventemitter3/index.js var require_eventemitter3=_ _commonJS({ "../../../node_modules/eventemitter3/index.js"(exports, module) { "use strict"; var has=O bject.prototype.hasOwnProperty; var prefix2="~" ; function Events() { } if (Object.create) { Events.prototype=/ * @__PURE__ */ Object.create(null); if (!new Events().__proto__) prefix2=f alse; } function EE(fn, context, once) { this.fn=f n; this.context=c ontext; this.once=o nce || false; } function addListener(emitter, event, fn, context, once) { if (typeof fn !=="function" ) { throw new TypeError( "The listener must be a function"); } var listener=n ew EE(fn, context || emitter, once), evt=p refix2 ? prefix2 + event : event; if (!emitter._events[evt]) emitter._events[evt]=l istener, emitter._eventsCount++; else if (!emitter._events[evt].fn) emitter._events[evt].push(listener); else emitter._events[evt]=[ emitter._events[evt], listener]; return emitter; } function clearEvent(emitter, evt) { if (--emitter._eventsCount===0 ) emitter._events=n ew Events(); else delete emitter._events[evt]; } function EventEmitter2() { this._events=n ew Events(); this._eventsCount=0 ; } EventEmitter2.prototype.eventNames=f unction eventNames() { var names=[ ], events2, name; if (this._eventsCount===0 ) return names; for (name in events2=t his._events) { if (has.call(events2, name)) names.push(prefix2 ? name.slice(1) : name); } if (Object.getOwnPropertySymbols) { return names.concat(Object.getOwnPropertySymbols(events2)); } return names; }; EventEmitter2.prototype.listeners=f unction listeners(event) { var evt=p refix2 ? prefix2 + event : event, handlers=t his._events[evt]; if (!handlers) return []; if (handlers.fn) return [handlers.fn]; for (var i=0 , l=h andlers.length, ee=n ew Array(l); i < l; i++) { ee[i]=h andlers[i].fn; } return ee; }; EventEmitter2.prototype.listenerCount=f unction listenerCount(event) { var evt=p refix2 ? prefix2 + event : event, listeners=t his._events[evt]; if (!listeners) return 0; if (listeners.fn) return 1; return listeners.length; }; EventEmitter2.prototype.emit=f unction emit(event, a1, a2, a3, a4, a5) { var evt=p refix2 ? prefix2 + event : event; if (!this._events[evt]) return false; var listeners=t his._events[evt], len=a rguments.length, args, i; if (listeners.fn) { if (listeners.once) this.removeListener(event, listeners.fn, void 0, true); switch (len) { case 1: return listeners.fn.call(listeners.context), true; case 2: return listeners.fn.call(listeners.context, a1), true; case 3: return listeners.fn.call(listeners.context, a1, a2), true; case 4: return listeners.fn.call(listeners.context, a1, a2, a3), true; case 5: return listeners.fn.call(listeners.context, a1, a2, a3, a4), true; case 6: return listeners.fn.call(listeners.context, a1, a2, a3, a4, a5), true; } for (i=1 , args=n ew Array(len - 1); i < len; i++) { args[i - 1]=a rguments[i]; } listeners.fn.apply(listeners.context, args); } else { var length=l isteners.length, j; for (i=0 ; i < length; i++) { if (listeners[i].once) this.removeListener(event, listeners[i].fn, void 0, true); switch (len) { case 1: listeners[i].fn.call(listeners[i].context); break; case 2: listeners[i].fn.call(listeners[i].context, a1); break; case 3: listeners[i].fn.call(listeners[i].context, a1, a2); break; case 4: listeners[i].fn.call(listeners[i].context, a1, a2, a3); break; default: if (!args) for (j=1 , args=n ew Array(len - 1); j < len; j++) { args[j - 1]=a rguments[j]; } listeners[i].fn.apply(listeners[i].context, args); } } } return true; }; EventEmitter2.prototype.on=f unction on(event, fn, context) { return addListener(this, event, fn, context, false); }; EventEmitter2.prototype.once=f unction once(event, fn, context) { return addListener(this, event, fn, context, true); }; EventEmitter2.prototype.removeListener=f unction removeListener(event, fn, context, once) { var evt=p refix2 ? prefix2 + event : event; if (!this._events[evt]) return this; if (!fn) { clearEvent(this, evt); return this; } var listeners=t his._events[evt]; if (listeners.fn) { if (listeners.fn===f n && (!once || listeners.once) && (!context || listeners.context===c ontext)) { clearEvent(this, evt); } } else { for (var i=0 , events2=[ ], length=l isteners.length; i < length; i++) { if (listeners[i].fn !==f n || once && !listeners[i].once || context && listeners[i].context !==c ontext) { events2.push(listeners[i]); } } if (events2.length) this._events[evt]=e vents2.length===1 ? events2[0] : events2; else clearEvent(this, evt); } return this; }; EventEmitter2.prototype.removeAllListeners=f unction removeAllListeners(event) { var evt; if (event) { evt=p refix2 ? prefix2 + event : event; if (this._events[evt]) clearEvent(this, evt); } else { this._events=n ew Events(); this._eventsCount=0 ; } return this; }; EventEmitter2.prototype.off=E ventEmitter2.prototype.removeListener; EventEmitter2.prototype.addListener=E ventEmitter2.prototype.on; EventEmitter2.prefixed=p refix2; EventEmitter2.EventEmitter=E ventEmitter2; if ( "undefined" !==t ypeof module) { module.exports=E ventEmitter2; } } }); // ../../../node_modules/process/browser.js var require_browser=_ _commonJS({ "../../../node_modules/process/browser.js"(exports, module) { var process13=m odule.exports={ }; var cachedSetTimeout; var cachedClearTimeout; function defaultSetTimout() { throw new Error( "setTimeout has not been defined"); } function defaultClearTimeout() { throw new Error( "clearTimeout has not been defined"); } (function() { try { if (typeof setTimeout==="function" ) { cachedSetTimeout=s etTimeout; } else { cachedSetTimeout=d efaultSetTimout; } } catch (e) { cachedSetTimeout=d efaultSetTimout; } try { if (typeof clearTimeout==="function" ) { cachedClearTimeout=c learTimeout; } else { cachedClearTimeout=d efaultClearTimeout; } } catch (e) { cachedClearTimeout=d efaultClearTimeout; } })(); function runTimeout(fun) { if (cachedSetTimeout===s etTimeout) { return setTimeout(fun, 0); } if ((cachedSetTimeout===d efaultSetTimout || !cachedSetTimeout) && setTimeout) { cachedSetTimeout=s etTimeout; return setTimeout(fun, 0); } try { return cachedSetTimeout(fun, 0); } catch (e) { try { return cachedSetTimeout.call(null, fun, 0); } catch (e2) { return cachedSetTimeout.call(this, fun, 0); } } } function runClearTimeout(marker) { if (cachedClearTimeout===c learTimeout) { return clearTimeout(marker); } if ((cachedClearTimeout===d efaultClearTimeout || !cachedClearTimeout) && clearTimeout) { cachedClearTimeout=c learTimeout; return clearTimeout(marker); } try { return cachedClearTimeout(marker); } catch (e) { try { return cachedClearTimeout.call(null, marker); } catch (e2) { return cachedClearTimeout.call(this, marker); } } } var queue=[ ]; var draining=f alse; var currentQueue; var queueIndex=- 1; function cleanUpNextTick() { if (!draining || !currentQueue) { return; } draining=f alse; if (currentQueue.length) { queue=c urrentQueue.concat(queue); } else { queueIndex=- 1; } if (queue.length) { drainQueue(); } } function drainQueue() { if (draining) { return; } var timeout=r unTimeout(cleanUpNextTick); draining=t rue; var len=q ueue.length; while (len) { currentQueue=q ueue; queue=[ ]; while (++queueIndex < len) { if (currentQueue) { currentQueue[queueIndex].run(); } } queueIndex=- 1; len=q ueue.length; } currentQueue=n ull; draining=f alse; runClearTimeout(timeout); } process13.nextTick=f unction(fun) { var args=n ew Array(arguments.length - 1); if (arguments.length> 1) { for (var i = 1; i < arguments.length; i++) { args[i - 1]=a rguments[i]; } } queue.push(new Item(fun, args)); if (queue.length===1 && !draining) { runTimeout(drainQueue); } }; function Item(fun, array) { this.fun=f un; this.array=a rray; } Item.prototype.run=f unction() { this.fun.apply(null, this.array); }; process13.title="browser" ; process13.browser=t rue; process13.env={ }; process13.argv=[ ]; process13.version="" ; process13.versions={ }; function noop() { } process13.on=n oop; process13.addListener=n oop; process13.once=n oop; process13.off=n oop; process13.removeListener=n oop; process13.removeAllListeners=n oop; process13.emit=n oop; process13.prependListener=n oop; process13.prependOnceListener=n oop; process13.listeners=f unction(name) { return []; }; process13.binding=f unction(name) { throw new Error( "process.binding is not supported"); }; process13.cwd=f unction() { return "/"; }; process13.chdir=f unction(dir) { throw new Error( "process.chdir is not supported"); }; process13.umask=f unction() { return 0; }; } }); // ../../../node_modules/react-is/cjs/react-is.production.min.js var require_react_is_production_min=_ _commonJS({ "../../../node_modules/react-is/cjs/react-is.production.min.js"(exports) { "use strict"; var b="function"===t ypeof Symbol && Symbol.for; var c=b ? Symbol.for( "react.element") : 60103; var d=b ? Symbol.for( "react.portal") : 60106; var e=b ? Symbol.for( "react.fragment") : 60107; var f=b ? Symbol.for( "react.strict_mode") : 60108; var g=b ? Symbol.for( "react.profiler") : 60114; var h=b ? Symbol.for( "react.provider") : 60109; var k=b ? Symbol.for( "react.context") : 60110; var l=b ? Symbol.for( "react.async_mode") : 60111; var m2=b ? Symbol.for( "react.concurrent_mode") : 60111; var n=b ? Symbol.for( "react.forward_ref") : 60112; var p=b ? Symbol.for( "react.suspense") : 60113; var q=b ? Symbol.for( "react.suspense_list") : 60120; var r=b ? Symbol.for( "react.memo") : 60115; var t=b ? Symbol.for( "react.lazy") : 60116; var v=b ? Symbol.for( "react.block") : 60121; var w=b ? Symbol.for( "react.fundamental") : 60117; var x=b ? Symbol.for( "react.responder") : 60118; var y=b ? Symbol.for( "react.scope") : 60119; function z(a) { if ( "object"===t ypeof a && null !==a ) { var u=a .$$typeof; switch (u) { case c: switch (a=a .type, a) { case l: case m2: case e: case g: case f: case p: return a; default: switch (a=a && a.$$typeof, a) { case k: case n: case t: case r: case h: return a; default: return u; } } case d: return u; } } } function A(a) { return z(a)===m 2; } exports.AsyncMode=l ; exports.ConcurrentMode=m 2; exports.ContextConsumer=k ; exports.ContextProvider=h ; exports.Element=c ; exports.ForwardRef=n ; exports.Fragment=e ; exports.Lazy=t ; exports.Memo=r ; exports.Portal=d ; exports.Profiler=g ; exports.StrictMode=f ; exports.Suspense=p ; exports.isAsyncMode=f unction(a) { return A(a) || z(a)===l ; }; exports.isConcurrentMode=A ; exports.isContextConsumer=f unction(a) { return z(a)===k ; }; exports.isContextProvider=f unction(a) { return z(a)===h ; }; exports.isElement=f unction(a) { return "object"===t ypeof a && null !==a && a.$$typeof===c ; }; exports.isForwardRef=f unction(a) { return z(a)===n ; }; exports.isFragment=f unction(a) { return z(a)===e ; }; exports.isLazy=f unction(a) { return z(a)===t ; }; exports.isMemo=f unction(a) { return z(a)===r ; }; exports.isPortal=f unction(a) { return z(a)===d ; }; exports.isProfiler=f unction(a) { return z(a)===g ; }; exports.isStrictMode=f unction(a) { return z(a)===f ; }; exports.isSuspense=f unction(a) { return z(a)===p ; }; exports.isValidElementType=f unction(a) { return "string"===t ypeof a || "function"===t ypeof a || a===e || a===m 2 || a===g || a===f || a===p || a===q || "object"===t ypeof a && null !==a && (a.$$typeof===t || a.$$typeof===r || a.$$typeof===h || a.$$typeof===k || a.$$typeof===n || a.$$typeof===w || a.$$typeof===x || a.$$typeof===y || a.$$typeof===v ); }; exports.typeOf=z ; } }); // ../../../node_modules/react-is/index.js var require_react_is=_ _commonJS({ "../../../node_modules/react-is/index.js"(exports, module) { "use strict"; if (true) { module.exports=r equire_react_is_production_min(); } else { module.exports=n ull; } } }); // ../../../node_modules/hoist-non-react-statics/dist/hoist-non-react-statics.cjs.js var require_hoist_non_react_statics_cjs=_ _commonJS({ "../../../node_modules/hoist-non-react-statics/dist/hoist-non-react-statics.cjs.js"(exports, module) { "use strict"; var reactIs=r equire_react_is(); var REACT_STATICS={ childContextTypes: true, contextType: true, contextTypes: true, defaultProps: true, displayName: true, getDefaultProps: true, getDerivedStateFromError: true, getDerivedStateFromProps: true, mixins: true, propTypes: true, type: true }; var KNOWN_STATICS={ name: true, length: true, prototype: true, caller: true, callee: true, arguments: true, arity: true }; var FORWARD_REF_STATICS={ "$$typeof": true, render: true, defaultProps: true, displayName: true, propTypes: true }; var MEMO_STATICS={ "$$typeof": true, compare: true, defaultProps: true, displayName: true, propTypes: true, type: true }; var TYPE_STATICS={ }; TYPE_STATICS[reactIs.ForwardRef]=F ORWARD_REF_STATICS; TYPE_STATICS[reactIs.Memo]=M EMO_STATICS; function getStatics(component) { if (reactIs.isMemo(component)) { return MEMO_STATICS; } return TYPE_STATICS[component[ "$$typeof"]] || REACT_STATICS; } var defineProperty=O bject.defineProperty; var getOwnPropertyNames=O bject.getOwnPropertyNames; var getOwnPropertySymbols=O bject.getOwnPropertySymbols; var getOwnPropertyDescriptor=O bject.getOwnPropertyDescriptor; var getPrototypeOf=O bject.getPrototypeOf; var objectPrototype=O bject.prototype; function hoistNonReactStatics(targetComponent, sourceComponent, blacklist) { if (typeof sourceComponent !=="string" ) { if (objectPrototype) { var inheritedComponent=g etPrototypeOf(sourceComponent); if (inheritedComponent && inheritedComponent !==o bjectPrototype) { hoistNonReactStatics(targetComponent, inheritedComponent, blacklist); } } var keys3=g etOwnPropertyNames(sourceComponent); if (getOwnPropertySymbols) { keys3=k eys3.concat(getOwnPropertySymbols(sourceComponent)); } var targetStatics=g etStatics(targetComponent); var sourceStatics=g etStatics(sourceComponent); for (var i=0 ; i < keys3.length; ++i) { var key7=k eys3[i]; if (!KNOWN_STATICS[key7] && !(blacklist && blacklist[key7]) && !(sourceStatics && sourceStatics[key7]) && !(targetStatics && targetStatics[key7])) { var descriptor=g etOwnPropertyDescriptor(sourceComponent, key7); try { defineProperty(targetComponent, key7, descriptor); } catch (e) { } } } } return targetComponent; } module.exports=h oistNonReactStatics; } }); // ../../../node_modules/fontfaceobserver/fontfaceobserver.standalone.js var require_fontfaceobserver_standalone=_ _commonJS({ "../../../node_modules/fontfaceobserver/fontfaceobserver.standalone.js"(exports, module) { (function() { function l(a, b) { document.addEventListener ? a.addEventListener( "scroll", b, false) : a.attachEvent( "scroll", b); } function m2(a) { document.body ? a() : document.addEventListener ? document.addEventListener( "DOMContentLoaded", function c() { document.removeEventListener( "DOMContentLoaded", c); a(); }) : document.attachEvent( "onreadystatechange", function k() { if ( "interactive"==d ocument.readyState || "complete"==d ocument.readyState) document.detachEvent( "onreadystatechange", k), a(); }); } ; function t(a) { this.a=d ocument.createElement( "div"); this.a.setAttribute( "aria-hidden", "true"); this.a.appendChild(document.createTextNode(a)); this.b=d ocument.createElement( "span"); this.c=d ocument.createElement( "span"); this.h=d ocument.createElement( "span"); this.f=d ocument.createElement( "span"); this.g=- 1; this.b.style.cssText="max-width:none;display:inline-block;position:absolute;height:100%;width:100%;overflow:scroll;font-size:16px;" ; this.c.style.cssText="max-width:none;display:inline-block;position:absolute;height:100%;width:100%;overflow:scroll;font-size:16px;" ; this.f.style.cssText="max-width:none;display:inline-block;position:absolute;height:100%;width:100%;overflow:scroll;font-size:16px;" ; this.h.style.cssText="display:inline-block;width:200%;height:200%;font-size:16px;max-width:none;" ; this.b.appendChild(this.h); this.c.appendChild(this.f); this.a.appendChild(this.b); this.a.appendChild(this.c); } function u(a, b) { a.a.style.cssText="max-width:none;min-width:20px;min-height:20px;display:inline-block;overflow:hidden;position:absolute;width:auto;margin:0;padding:0;top:-999px;white-space:nowrap;font-synthesis:none;font:" + b + ";"; } function z(a) { var b=a .a.offsetWidth, c=b + 100; a.f.style.width=c + "px"; a.c.scrollLeft=c ; a.b.scrollLeft=a .b.scrollWidth + 100; return a.g !==b ? (a.g=b , true) : false; } function A(a, b) { function c() { var a2=k ; z(a2) && a2.a.parentNode && b(a2.g); } var k=a ; l(a.b, c); l(a.c, c); z(a); } ; function B(a, b) { var c=b || {}; this.family=a ; this.style=c .style || "normal"; this.weight=c .weight || "normal"; this.stretch=c .stretch || "normal"; } var C=n ull, D=n ull, E=n ull, F=n ull; function G() { if (null===D ) if (J() && /Apple/.test(window.navigator.vendor)) { var a=/ AppleWebKit\/([0-9]+)(?:\.([0-9]+))(?:\.([0-9]+))/.exec(window.navigator.userAgent); D=! !a && 603> parseInt(a[1], 10); } else D = false; return D; } function J() { null === F && (F = !!document.fonts); return F; } function K() { if (null === E) { var a = document.createElement("div"); try { a.style.font = "condensed 100px sans-serif"; } catch (b) { } E = "" !== a.style.font; } return E; } function L(a, b) { return [a.style, a.weight, K() ? a.stretch : "", "100px", b].join(" "); } B.prototype.load = function(a, b) { var c = this, k = a || "BESbswy", r = 0, n = b || 3e3, H = (/* @__PURE__ */ new Date()).getTime(); return new Promise(function(a2, b2) { if (J() && !G()) { var M = new Promise(function(a3, b3) { function e() { (/* @__PURE__ */ new Date()).getTime() - H >= n ? b3(Error("" + n + "ms timeout exceeded")) : document.fonts.load(L(c, '"' + c.family + '"'), k).then(function(c2) { 1 <=c 2.length ? a3() : setTimeout(e, 25); }, b3); } e(); }), N=n ew Promise(function(a3, c2) { r=s etTimeout(function() { c2(Error( "" + n + "ms timeout exceeded")); }, n); }); Promise.race([N, M]).then( function() { clearTimeout(r); a2(c); }, b2 ); } else m2(function() { function v() { var b3; if (b3=- 1 !=f && -1 !=g || -1 !=f && -1 !=h || -1 !=g && -1 !=h ) (b3=f !=g && f !=h && g !=h ) || (null===C && (b3=/ AppleWebKit\/([0-9]+)(?:\.([0-9]+))/.exec(window.navigator.userAgent), C=! !b3 && (536> parseInt(b3[1], 10) || 536 === parseInt(b3[1], 10) && 11 >= parseInt(b3[2], 10))), b3 = C && (f == w && g == w && h == w || f == x && g == x && h == x || f == y && g == y && h == y)), b3 = !b3; b3 && (d.parentNode && d.parentNode.removeChild(d), clearTimeout(r), a2(c)); } function I() { if ((/* @__PURE__ */ new Date()).getTime() - H >= n) d.parentNode && d.parentNode.removeChild(d), b2(Error("" + n + "ms timeout exceeded")); else { var a3 = document.hidden; if (true === a3 || void 0 === a3) f = e.a.offsetWidth, g = p.a.offsetWidth, h = q.a.offsetWidth, v(); r = setTimeout(I, 50); } } var e = new t(k), p = new t(k), q = new t(k), f = -1, g = -1, h = -1, w = -1, x = -1, y = -1, d = document.createElement("div"); d.dir = "ltr"; u(e, L(c, "sans-serif")); u(p, L(c, "serif")); u(q, L(c, "monospace")); d.appendChild(e.a); d.appendChild(p.a); d.appendChild(q.a); document.body.appendChild(d); w = e.a.offsetWidth; x = p.a.offsetWidth; y = q.a.offsetWidth; I(); A(e, function(a3) { f = a3; v(); }); u( e, L(c, '"' + c.family + '",sans-serif') ); A(p, function(a3) { g = a3; v(); }); u(p, L(c, '"' + c.family + '",serif')); A(q, function(a3) { h = a3; v(); }); u(q, L(c, '"' + c.family + '",monospace')); }); }); }; "object" === typeof module ? module.exports = B : (window.FontFaceObserver = B, window.FontFaceObserver.prototype.load = B.prototype.load); })(); } }); // ../../router/build/computeRelativePath.js function computeRelativePath(from, to) { if (!from.startsWith("/") || !to.startsWith("/")) { throw new Error("from/to paths are expected to be absolute"); } const [fromDir] = getDirAndFile(from); const [toDir, toFile] = getDirAndFile(to); let relativePath = relative(fromDir, toDir); if (relativePath === "") relativePath = "."; if (!relativePath.startsWith(".") && !relativePath.startsWith("/")) { relativePath = "./" + relativePath; } return relativePath + "/" + toFile; } function getDirAndFile(path) { const index = path.lastIndexOf("/"); return [path.substring(0, index + 1), path.substring(index + 1)]; } var CHAR_DOT = 46; var CHAR_FORWARD_SLASH = 47; var StringPrototypeCharCodeAt = (str, index) => str.charCodeAt(index); var StringPrototypeLastIndexOf = (str, searchString) => str.lastIndexOf(searchString); var StringPrototypeSlice = (str, start, end) => str.slice(start, end); function relative(from, to) { if (from === to) return ""; from = "/" + normalizeString(from); to = "/" + normalizeString(to); if (from === to) return ""; const fromStart = 1; const fromEnd = from.length; const fromLen = fromEnd - fromStart; const toStart = 1; const toLen = to.length - toStart; const length = fromLen < toLen ? fromLen : toLen; let lastCommonSep=- 1; let i=0 ; for (; i < length; i++) { const fromCode=S tringPrototypeCharCodeAt(from, fromStart + i); if (fromCode !==S tringPrototypeCharCodeAt(to, toStart + i)) break; else if (fromCode===C HAR_FORWARD_SLASH) lastCommonSep=i ; } if (i===l ength) { if (toLen> length) { if (StringPrototypeCharCodeAt(to, toStart + i) === CHAR_FORWARD_SLASH) { return StringPrototypeSlice(to, toStart + i + 1); } if (i === 0) { return StringPrototypeSlice(to, toStart + i); } } else if (fromLen > length) { if (StringPrototypeCharCodeAt(from, fromStart + i) === CHAR_FORWARD_SLASH) { lastCommonSep = i; } else if (i === 0) { lastCommonSep = 0; } } } let out = ""; for (i = fromStart + lastCommonSep + 1; i <=f romEnd; ++i) { if (i===f romEnd || StringPrototypeCharCodeAt(from, i)===C HAR_FORWARD_SLASH) { out +=o ut.length===0 ? ".." : "/.."; } } return `${out}${StringPrototypeSlice(to, toStart + lastCommonSep)}`; } var allowAboveRoot=f alse; var separator="/" ; var isPathSeparator=( code)=> code === CHAR_FORWARD_SLASH; function normalizeString(path) { let res = ""; let lastSegmentLength = 0; let lastSlash = -1; let dots = 0; let code = 0; for (let i = 0; i <=p ath.length; ++i) { if (i < path.length) code=S tringPrototypeCharCodeAt(path, i); else if (isPathSeparator(code)) break; else code=C HAR_FORWARD_SLASH; if (isPathSeparator(code)) { if (lastSlash===i - 1 || dots===1 ) { } else if (dots===2 ) { if (res.length < 2 || lastSegmentLength !==2 || StringPrototypeCharCodeAt(res, res.length - 1) !==C HAR_DOT || StringPrototypeCharCodeAt(res, res.length - 2) !==C HAR_DOT) { if (res.length> 2) { const lastSlashIndex = StringPrototypeLastIndexOf(res, separator); if (lastSlashIndex === -1) { res = ""; lastSegmentLength = 0; } else { res = StringPrototypeSlice(res, 0, lastSlashIndex); lastSegmentLength = res.length - 1 - StringPrototypeLastIndexOf(res, separator); } lastSlash = i; dots = 0; continue; } else if (res.length !== 0) { res = ""; lastSegmentLength = 0; lastSlash = i; dots = 0; continue; } } if (allowAboveRoot) { res += res.length > 0 ? `${separator}..` : ".."; lastSegmentLength = 2; } } else { if (res.length > 0) res += `${separator}${StringPrototypeSlice(path, lastSlash + 1, i)}`; else res = StringPrototypeSlice(path, lastSlash + 1, i); lastSegmentLength = i - lastSlash - 1; } lastSlash = i; dots = 0; } else if (code === CHAR_DOT && dots !== -1) { ++dots; } else { dots = -1; } } return res; } // ../../router/build/ErrorBoundary.js import { Component } from "react"; // ../../router/build/renderPage.js import React2 from "react"; // ../../router/build/utils.js import React from "react"; function isObject(value) { return typeof value === "object" && value !== null && !Array.isArray(value); } function isString(value) { return typeof value === "string"; } var preloadKey = "preload"; function isLazyComponentType(componentType) { return typeof componentType === "object" && preloadKey in componentType; } function lazy(factory) { const LazyComponent = React.lazy(factory); let factoryPromise; let LoadedComponent; const Component15 = React.forwardRef(function LazyWithPreload(props, ref) { return React.createElement(LoadedComponent !== null && LoadedComponent !== void 0 ? LoadedComponent : LazyComponent, Object.assign(ref ? { ref } : {}, props)); }); Component15.preload = () => { if (!factoryPromise) { factoryPromise = factory().then((module) => { LoadedComponent = module.default; return LoadedComponent; }); } return factoryPromise; }; return Component15; } function getRouteElementId(route, hash2) { if (hash2 && route) { if (route.elements && hash2 in route.elements) { return route.elements[hash2]; } else { return hash2; } } return void 0; } // ../../router/build/renderPage.js function renderPage(Page4, defaultPageStyle = {}) { const element = React2.isValidElement(Page4) ? React2.cloneElement(Page4, { style: defaultPageStyle }) : React2.createElement(Page4, { style: defaultPageStyle }); if (isLazyComponentType(element.type)) { return React2.createElement(React2.Suspense, { fallback: null }, element); } return element; } // ../../router/build/ErrorBoundary.js var NotFoundError = class extends Error { }; var ErrorBoundary = class extends Component { constructor(props) { super(props); this.state = { error: void 0, forceUpdateKey: props.forceUpdateKey }; } static getDerivedStateFromError(error) { return { error }; } /** Resets the error when forceUpdateKey gets bumped. */ static getDerivedStateFromProps(nextProps, prevState) { if (nextProps.forceUpdateKey !== prevState.forceUpdateKey) { const newState = { forceUpdateKey: nextProps.forceUpdateKey }; if (prevState.error) { newState.error = void 0; } return newState; } return null; } render() { if (this.state.error === void 0) { return this.props.children; } if (!(this.state.error instanceof NotFoundError)) { throw this.state.error; } const { notFoundPage, defaultPageStyle } = this.props; if (!notFoundPage) { throw this.state.error; } return renderPage(notFoundPage, defaultPageStyle); } }; // ../../router/build/history.js import React3 from "react"; // ../../router/build/pathVariables.js var pathVariablesRegExpRaw = ":([a-zA-Z][a-zA-Z0-9_]*)"; var pathVariablesRegExp = new RegExp(pathVariablesRegExpRaw, "g"); // ../../router/build/history.js function pushRouteState(routeId, route, { currentRoutePath, hash: hash2, pathVariables } = {}) { const { path } = route; if (path) { try { const newPath = getPathForRoute(route, { currentRoutePath, hash: hash2, pathVariables }); window.history.pushState({ routeId, hash: hash2, pathVariables }, "", newPath); } catch { } } } function useReplaceInitialState({ disabled, routeId, initialPathVariables }) { React3.useEffect(() => { if (disabled) return; window.history.replaceState({ routeId, pathVariables: initialPathVariables }, ""); }, []); } function usePopStateHandler(setCurrentRouteId) { const popStateHandler = React3.useCallback(({ state }) => { if (!isObject(state)) return; const { routeId, hash: hash2, pathVariables } = state; if (!isString(routeId)) return; setCurrentRouteId(routeId, isString(hash2) ? hash2 : void 0, isObject(pathVariables) ? pathVariables : void 0); }, [setCurrentRouteId]); React3.useEffect(() => { window.addEventListener("popstate", popStateHandler); return () => window.removeEventListener("popstate", popStateHandler); }, [popStateHandler]); } function getHashForRoute(hash2, route, hashVariables) { const resolvedHash = getRouteElementId(route, hash2); if (!resolvedHash) return void 0; const variables = Object.assign({}, route === null || route === void 0 ? void 0 : route.elements, hashVariables); return resolvedHash.replace(pathVariablesRegExp, (m2, p1) => { var _a; return String((_a = variables[p1]) !== null && _a !== void 0 ? _a : m2); }); } function getPathForRoute(route, { currentRoutePath, hash: hash2, pathVariables, hashVariables, relative: relative2 = true }) { var _a; const currentPath = currentRoutePath !== null && currentRoutePath !== void 0 ? currentRoutePath : "/"; const targetPath = (_a = route === null || route === void 0 ? void 0 : route.path) !== null && _a !== void 0 ? _a : "/"; let path = targetPath; if (pathVariables) { path = path.replace(pathVariablesRegExp, (m2, p1) => { var _a2; return String((_a2 = pathVariables[p1]) !== null && _a2 !== void 0 ? _a2 : m2); }); } if (relative2) { path = computeRelativePath(currentPath, path); } const resolvedHash = getHashForRoute(hash2, route, hashVariables); return resolvedHash ? `${path}#${resolvedHash}` : path; } // ../../router/build/inferInitialRouteFromPath.js var memoPathRoutes; var memoPaths; var lastRoutes; function getRouteInfoMemo(routes) { if (lastRoutes !== routes) { memoPathRoutes = {}; for (const [routeId, { path }] of Object.entries(routes)) { if (path) memoPathRoutes[path] = { path, depth: pathDepth(path), routeId }; } memoPaths = Object.values(memoPathRoutes); memoPaths.sort(({ depth: depth1 }, { depth: depth2 }) => depth2 - depth1); lastRoutes = routes; } return [memoPathRoutes, memoPaths]; } function inferInitialRouteFromPath(routes, decodedLocationPath, fallback = true) { const [pathRoutes, paths] = getRouteInfoMemo(routes); const exactMatch = pathRoutes[decodedLocationPath]; if (exactMatch) { const match = matchPath(decodedLocationPath, exactMatch.path); if (match.isMatch) return { routeId: exactMatch.routeId, pathVariables: match.pathVariables }; } for (const { path, routeId } of paths) { const match = matchPath(decodedLocationPath, path); if (match.isMatch) return { routeId, pathVariables: match.pathVariables }; } if (!fallback) throw new Error("No exact match found for path"); const rootPath = pathRoutes["/"]; if (rootPath) return { routeId: rootPath.routeId }; const firstRoute = Object.keys(routes)[0]; if (!firstRoute) throw new Error("Router should not have undefined routes"); return { routeId: firstRoute }; } function pathDepth(path) { const pathWithTrimmedSlashes = path.replace(/(?:^\/|\/$)/g, ""); if (pathWithTrimmedSlashes === "") return 0; return pathWithTrimmedSlashes.split("/").length; } function matchPath(path, routePath) { const pathVariablesKeys = []; const safeRoutePath = escapeStringRegExp(routePath); const routePathRegExpString = safeRoutePath.replace(pathVariablesRegExp, (_, name) => { pathVariablesKeys.push(name); return "([^/]+)"; }); const routePathRegExp = new RegExp(routePathRegExpString + "$"); const matches = path.match(routePathRegExp); if (!matches) return { isMatch: false }; if (matches.length === 1) return { isMatch: true }; const pathVariables = {}; const pathVariablesValues = matches.slice(1); for (let i = 0; i < pathVariablesKeys.length; ++i) { const key7=p athVariablesKeys[i]; if (key7===v oid 0) continue; const value=p athVariablesValues[i]; const existingValue=p athVariables[key7]; if (existingValue) { if (existingValue !==v alue) { return { isMatch: false }; } else { continue; } } if (value===v oid 0) { throw new Error( "Path variable values cannot be undefined"); } pathVariables[key7]=v alue; } return { isMatch: true, pathVariables }; } function escapeStringRegExp(string) { return string.replace(/[|\\{}()[\]^$+*?.]/g, "\\$&").replace(/-/g, "\\x2d"); } // ../../router/build/isRoute.js var key="page" ; function isRoute(route) { return isObject(route) && key in route && route.page !==v oid 0; } // ../../router/build/Router.js import React7, { startTransition } from "react"; // ../../router/build/fillPathVariables.js function fillPathVariables(path, variables) { return path.replace(pathVariablesRegExp, (match, name)=> { const value = variables[name]; if (typeof value !== "string" || value.length === 0) return match; return encodeURIComponent(value); }); } // ../../router/build/isSamePage.js function isSamePage(a, b) { if (a.routeId !== b.routeId) return false; if (a.pathVariables === b.pathVariables) return true; const aPathVariables = a.pathVariables || {}; const bPathVariables = b.pathVariables || {}; return aPathVariables.length === bPathVariables.length && Object.keys(aPathVariables).every((key7) => aPathVariables[key7] === bPathVariables[key7]); } // ../../router/build/RouterContext.js import React5 from "react"; // ../../router/build/useGetRouteCallback.js import React4 from "react"; function useGetRouteCallback(routes) { return React4.useCallback((routeId) => routes[routeId], [routes]); } // ../../router/build/RouterContext.js var RouterContext = React5.createContext({}); function RouterAPIProvider({ api, children }) { return React5.createElement(RouterContext.Provider, { value: api }, children); } function useRouter() { return React5.useContext(RouterContext); } function RoutesProvider({ routes, children }) { const getRoute = useGetRouteCallback(routes); return React5.createElement(RouterContext.Provider, { value: { getRoute } }, children); } // ../../router/build/useForceUpdate.js import React6 from "react"; function useForceUpdate2() { const [_, setForcedRenderCount] = React6.useState(0); return [_, React6.useCallback(() => setForcedRenderCount((v) => v + 1), [])]; } // ../../router/build/Router.js function updateScrollPosition(hash2, smoothScroll) { const element = hash2 && document.getElementById(hash2); if (element) { scrollElementIntoView(element, smoothScroll); return; } window.scrollTo(0, 0); } function useScheduleRenderSideEffects(dep) { const actions = React7.useRef([]); React7.useLayoutEffect(() => { var _a; if (!((_a = actions.current) === null || _a === void 0 ? void 0 : _a.length)) return; actions.current.forEach((action) => action()); actions.current = []; }, [dep]); return React7.useCallback((cb) => { actions.current.push(cb); }, []); } function Router({ defaultPageStyle, disableHistory, initialPathVariables, initialRoute, notFoundPage, routes }) { useReplaceInitialState({ disabled: disableHistory, routeId: initialRoute, initialPathVariables }); const currentRouteRef = React7.useRef(initialRoute); const currentPathVariablesRef = React7.useRef(initialPathVariables); const [dep, forceUpdate] = useForceUpdate2(); const scheduleSideEffect = useScheduleRenderSideEffects(dep); const setCurrentRouteId = React7.useCallback((routeId, hash2, pathVariables, smoothScroll = false) => { currentRouteRef.current = routeId; currentPathVariablesRef.current = pathVariables; scheduleSideEffect(() => { updateScrollPosition(hash2, smoothScroll); }); forceUpdate(); }, [forceUpdate, scheduleSideEffect]); usePopStateHandler(setCurrentRouteId); const navigate = React7.useCallback((routeId, hash2, pathVariables, smoothScroll) => { var _a, _b; const newRoute = routes[routeId]; if (pathVariables) { const inUse = /* @__PURE__ */ new Set(); const path = (_a = newRoute === null || newRoute === void 0 ? void 0 : newRoute.path) !== null && _a !== void 0 ? _a : "/"; for (const match of path.matchAll(pathVariablesRegExp)) { const usedVariable = match[1]; if (usedVariable === void 0) { throw new Error("A matching path variable should not be undefined"); } inUse.add(usedVariable); } pathVariables = Object.fromEntries(Object.entries(pathVariables).filter(([key7]) => inUse.has(key7))); } const routeElementId = getRouteElementId(newRoute, hash2); if (isSamePage({ routeId: currentRouteRef.current, pathVariables: currentPathVariablesRef.current }, { routeId, pathVariables })) { if (((_b = window.history.state) === null || _b === void 0 ? void 0 : _b.hash) !== hash2) { if (!disableHistory) { const route = routes[routeId]; if (route) { pushRouteState(routeId, route, { currentRoutePath: route.path, pathVariables, hash: hash2 }); } } } updateScrollPosition(routeElementId, smoothScroll); return; } if (!newRoute) return; if (!disableHistory) { const currentRoute = routes[currentRouteRef.current]; pushRouteState(routeId, newRoute, { currentRoutePath: currentRoute === null || currentRoute === void 0 ? void 0 : currentRoute.path, hash: hash2, pathVariables }); } startTransition(() => setCurrentRouteId(routeId, routeElementId, pathVariables, smoothScroll)); }, [routes, disableHistory, setCurrentRouteId]); const getRoute = useGetRouteCallback(routes); const currentRouteId = currentRouteRef.current; const currentPathVariables = currentPathVariablesRef.current; const api = React7.useMemo(() => ({ navigate, getRoute, currentRouteId, currentPathVariables, routes }), [navigate, getRoute, currentRouteId, currentPathVariables, routes]); const current = routes[currentRouteRef.current]; if (!current) { throw new Error(`Router cannot find route for ${currentRouteRef.current}`); } const pathWithFilledVariables = current.path && currentPathVariables ? fillPathVariables(current.path, currentPathVariables) : current.path; return React7.createElement( RouterAPIProvider, { api }, React7.createElement( ErrorBoundary, { notFoundPage, defaultPageStyle, forceUpdateKey: dep }, React7.createElement(React7.Fragment, { key: pathWithFilledVariables }, renderPage(current.page, defaultPageStyle)) ) ); } function scrollElementIntoView(element, smoothScroll) { const scrollIntoViewOptions = smoothScroll ? { behavior: "smooth", block: "start", inline: "nearest" } : void 0; element.scrollIntoView(scrollIntoViewOptions); } // ../../router/build/useCurrentRoute.js import React8, { useContext } from "react"; var CurrentRouteContext = React8.createContext(void 0); function useCurrentRoute() { var _a; const router = useRouter(); const override = useContext(CurrentRouteContext); const id = override !== null && override !== void 0 ? override : router.currentRouteId; if (!id) return void 0; const route = (_a = router.getRoute) === null || _a === void 0 ? void 0 : _a.call(router, id); if (!route) return void 0; return { ...route, id, pathVariables: override ? void 0 : router.currentPathVariables }; } function useCurrentRouteId() { var _a; return (_a = useCurrentRoute()) === null || _a === void 0 ? void 0 : _a.id; } // ../../router/build/useCurrentPathVariables.js function useCurrentPathVariables() { var _a; return (_a = useCurrentRoute()) === null || _a === void 0 ? void 0 : _a.pathVariables; } // ../../router/build/useRoute.js function useRoute(routeId) { var _a; const routerAPI = useRouter(); if (!routeId) return void 0; return (_a = routerAPI.getRoute) === null || _a === void 0 ? void 0 : _a.call(routerAPI, routeId); } // ../../router/build/useRouteAnchor.js import React10 from "react"; // ../../router/build/useRoutePreloader.js import React9 from "react"; function useRoutePreloader(routeIds, enabled = true) { const { getRoute } = useRouter(); React9.useEffect(() => { if (!getRoute || !enabled) return; for (const routeId of routeIds) { const route = getRoute(routeId); if (route === null || route === void 0 ? void 0 : route.page) preloadComponent(route.page); } }, [routeIds, getRoute, enabled]); } function preloadComponent(component) { if (component && !React9.isValidElement(component) && isLazyComponentType(component)) { void component.preload(); } } // ../../router/build/useRouteAnchor.js function useRouteAnchor(routeId, { elementId, hash: linkHash } = {}) { const { navigate } = useRouter(); const route = useRoute(routeId); const currentRouteId = useCurrentRouteId(); const currentRoute = useRoute(currentRouteId !== null && currentRouteId !== void 0 ? currentRouteId : ""); useRoutePreloader([routeId], true); const hash2 = linkHash !== null && linkHash !== void 0 ? linkHash : elementId; const href = React10.useMemo(() => getPathForRoute(route, { currentRoutePath: currentRoute === null || currentRoute === void 0 ? void 0 : currentRoute.path, hash: hash2 }), [currentRoute, hash2, route]); const navigateToRoute = React10.useCallback(() => navigate === null || navigate === void 0 ? void 0 : navigate(routeId, hash2), [hash2, navigate, routeId]); const onClick = React10.useCallback((event) => { event.preventDefault(); navigateToRoute(); }, [navigateToRoute]); return { onClick, href }; } // ../../router/build/useRouteElementId.js import React11 from "react"; function useRouteElementId(id, targetRouteId) { var _a; const currentRoute = useCurrentRoute(); const route = (_a = useRoute(targetRouteId)) !== null && _a !== void 0 ? _a : currentRoute; return React11.useMemo(() => getRouteElementId(route, id), [id, route]); } // ../../router/build/useRouteHandler.js import React12 from "react"; function useRouteHandler(routeId, preload = false, elementId) { const { navigate } = useRouter(); useRoutePreloader([routeId], preload); const handler = React12.useCallback(() => navigate === null || navigate === void 0 ? void 0 : navigate(routeId, elementId), [navigate, elementId, routeId]); return handler; } // ../../library/src/utils/warnOnce.ts var warningMessages = /* @__PURE__ */ new Set(); function warnOnce(keyMessage, ...rest) { if (warningMessages.has(keyMessage)) return; warningMessages.add(keyMessage); console.warn(keyMessage, ...rest); } // ../../library/src/utils/deprecation.ts function deprecationWarning(removedItem, removalVersion, replacement) { const replacementText = replacement ? `, use ${replacement} instead` : ""; const warningText = `Deprecation warning: ${removedItem} will be removed in version ${removalVersion}${replacementText}.`; warnOnce(warningText); } // ../../library/src/animation/Animatable/Observers.ts var Observers = class { constructor() { this.observers = /* @__PURE__ */ new Set(); this.transactions = {}; } add(observer) { this.observers.add(observer); let isCalled = false; return () => { if (isCalled) { return; } isCalled = true; this.remove(observer); }; } remove(observer) { this.observers.delete(observer); } notify(change, transaction) { if (transaction) { const accumulatedChange = this.transactions[transaction] || change; accumulatedChange.value = change.value; this.transactions[transaction] = accumulatedChange; } else { this.callObservers(change); } } finishTransaction(transaction) { const accumulatedChange = this.transactions[transaction]; delete this.transactions[transaction]; return this.callObservers(accumulatedChange, transaction); } callObservers(change, transaction) { const finishObservers = []; new Set(this.observers).forEach((observer) => { if (typeof observer === "function") { observer(change, transaction); } else { observer.update(change, transaction); finishObservers.push(observer.finish); } }); return finishObservers; } }; // ../../library/src/animation/Animatable/Animatable.ts var Animatable = /* @__PURE__ */ (() => { function Animatable2(value) { deprecationWarning("Animatable()", "2.0.0", "the new animation API (https://www.framer.com/api/animation/)"); return isAnimatable(value) ? value : new AnimatableValue(value); } Animatable2.transaction = (update) => { const transactionId = Math.random(); const updatedValues = /* @__PURE__ */ new Set(); const updater = (animatable, value) => { animatable.set(value, transactionId); updatedValues.add(animatable); }; update(updater, transactionId); const finishObservers = []; updatedValues.forEach((value) => { finishObservers.push(...value.finishTransaction(transactionId)); }); finishObservers.forEach((finish) => { finish(transactionId); }); }; Animatable2.getNumber = (value, defaultValue = 0) => { return Animatable2.get(value, defaultValue); }; Animatable2.get = (value, defaultValue) => { if (value === void 0 || value === null) { return defaultValue; } if (isAnimatable(value)) { return value.get(); } return value; }; Animatable2.objectToValues = (object) => { if (!object) { return object; } const result = {}; for (const key7 in object) { const value = object[key7]; if (isAnimatable(value)) { result[key7] = value.get(); } else { result[key7] = value; } } return result; }; return Animatable2; })(); var onUpdateKey = "onUpdate"; var finishTransactionKey = "finishTransaction"; function isAnimatable(value) { return value !== null && typeof value === "object" && onUpdateKey in value && value[onUpdateKey] instanceof Function && finishTransactionKey in value && value[finishTransactionKey] instanceof Function; } function animatableInterpolation(value, currentInterpolation) { return { interpolate(from, to) { const fromValue = from.get(); const toValue = to.get(); const result = Animatable(fromValue); return (progress2) => { const v = currentInterpolation.interpolate(fromValue, toValue)(progress2); result.set(v); return result; }; }, difference(from, to) { const v = from.get(); return currentInterpolation.difference(v, to.get()); } }; } var AnimatableValue = class { constructor(value) { this.value = value; this.observers = new Observers(); } static interpolationFor(value, currentInterpolation) { if (isAnimatable(value)) { return animatableInterpolation(value, currentInterpolation); } } get() { return this.value; } set(value, transaction) { const oldValue = this.value; if (isAnimatable(value)) { value = value.get(); } this.value = value; const change = { value, oldValue }; this.observers.notify(change, transaction); } finishTransaction(transaction) { return this.observers.finishTransaction(transaction); } onUpdate(handler) { return this.observers.add(handler); } }; // ../../library/src/render/utils/isMotionValue.ts var isMotionValue2 = (v) => v instanceof MotionValue; // ../../library/src/render/utils/roundedNumber.ts function roundedNumber(value, decimals) { const d = Math.round(Math.abs(decimals)); const multiplier = Math.pow(10, d); return Math.round(value * multiplier) / multiplier; } function roundedNumberString(value, decimals) { const result = value.toFixed(decimals); if (decimals === 0) { return result; } return result.replace(/\.?0+$/, ""); } function roundWithOffset(value, offset) { if (offset === 0) { return Math.round(value); } offset -= offset | 0; if (offset < 0) { offset=1 - offset; } return Math.round(value - offset) + offset; } // ../../library/src/render/types/Point.ts function Point(x, y) { return { x, y }; } ((Point3)=> { Point3.add = (...args) => { return args.reduce( (previousValue, currentValue) => { return { x: previousValue.x + currentValue.x, y: previousValue.y + currentValue.y }; }, { x: 0, y: 0 } ); }; Point3.subtract = (a, b) => { return { x: a.x - b.x, y: a.y - b.y }; }; Point3.multiply = (a, b) => { return { x: a.x * b, y: a.y * b }; }; Point3.divide = (a, b) => { return { x: a.x / b, y: a.y / b }; }; Point3.absolute = (point) => { return { x: Math.abs(point.x), y: Math.abs(point.y) }; }; Point3.reverse = (point) => { return { x: point.x * -1, y: point.y * -1 }; }; Point3.pixelAligned = (point, offset = { x: 0, y: 0 }) => { return { x: roundWithOffset(point.x, offset.x), y: roundWithOffset(point.y, offset.y) }; }; Point3.distance = (a, b) => { const deltaX = Math.abs(a.x - b.x); const deltaY = Math.abs(a.y - b.y); return Math.sqrt(deltaX * deltaX + deltaY * deltaY); }; Point3.angle = (a, b) => { return Math.atan2(b.y - a.y, b.x - a.x) * 180 / Math.PI - 90; }; Point3.isEqual = (a, b) => { return a.x === b.x && a.y === b.y; }; Point3.rotationNormalizer = () => { let lastValue; return (value) => { if (typeof lastValue !== "number") { lastValue = value; } const diff = lastValue - value; const maxDiff = Math.abs(diff) + 180; const nTimes = Math.floor(maxDiff / 360); if (diff < 180) { value -=n Times * 360; } if (diff> 180) { value += nTimes * 360; } lastValue = value; return value; }; }; function center(a, b) { return { x: (a.x + b.x) / 2, y: (a.y + b.y) / 2 }; } Point3.center = center; })(Point || (Point = {})); // ../../library/src/animation/Animators/BezierAnimator.ts var BezierDefaults = { curve: "ease" /* Ease */, duration: 1 }; function controlPointsForCurve(curve) { switch (curve) { case "linear" /* Linear */: return [0, 0, 1, 1]; case "ease" /* Ease */: return [0.25, 0.1, 0.25, 1]; case "ease-in" /* EaseIn */: return [0.42, 0, 1, 1]; case "ease-out" /* EaseOut */: return [0, 0, 0.58, 1]; case "ease-in-out" /* EaseInOut */: return [0.42, 0, 0.58, 1]; } } var BezierAnimator = class { constructor(options, interpolation) { this.interpolation = interpolation; this.progress = 0; this.next = (delta) => { const { duration } = this.options; this.progress += delta / duration; const value = this.unitBezier.solve(this.progress, this.solveEpsilon(duration)); this.current = this.interpolator(value); return this.current; }; this.options = { ...BezierDefaults, ...options }; let controlPoints; if (typeof this.options.curve === "string") { controlPoints = controlPointsForCurve(this.options.curve); } else { controlPoints = this.options.curve; } const [p1x, p1y, p2x, p2y] = controlPoints; this.unitBezier = new UnitBezier(Point(p1x, p1y), Point(p2x, p2y)); } setFrom(value) { this.current = value; this.updateInterpolator(); } setTo(value) { this.destination = value; this.updateInterpolator(); } isReady() { return this.interpolator !== void 0; } updateInterpolator() { if (this.current === void 0 || this.destination === void 0) { return; } this.interpolator = this.interpolation.interpolate(this.current, this.destination); } isFinished() { return this.progress >= 1; } solveEpsilon(duration) { return 1 / (200 * duration); } }; var UnitBezier = class { constructor(point1, point2) { this.c = Point.multiply(point1, 3); this.b = Point.subtract(Point.multiply(Point.subtract(point2, point1), 3), this.c); this.a = Point.subtract(Point.subtract(Point(1, 1), this.c), this.b); } solve(x, epsilon2) { return this.sampleY(this.solveForT(x, epsilon2)); } sampleX(t) { return ((this.a.x * t + this.b.x) * t + this.c.x) * t; } sampleY(t) { return ((this.a.y * t + this.b.y) * t + this.c.y) * t; } sampleDerivativeX(t) { return (3 * this.a.x * t + 2 * this.b.x) * t + this.c.x; } solveForT(x, epsilon2) { let t0, t1, t2, x2, d2, i; t2 = x; for (i = 0; i < 8; ++i) { x2=t his.sampleX(t2) - x; if (Math.abs(x2) < epsilon2) return t2; d2=t his.sampleDerivativeX(t2); if (Math.abs(d2) < epsilon2) break; t2=t 2 - x2 / d2; } t0=0 ; t1=1 ; t2=x ; if (t2 < t0) return t0; if (t2> t1) return t1; while (t0 < t1) { x2=t his.sampleX(t2); if (Math.abs(x2 - x) < epsilon2) return t2; if (x> x2) t0 = t2; else t1 = t2; t2 = (t1 - t0) * 0.5 + t0; } return t2; } }; // ../../library/src/animation/Animators/Integrator.ts var Integrator = class { constructor(accelerationFunction) { this.accelerationForState = accelerationFunction; } integrateState(state, dt) { const a = this.evaluateState(state); const b = this.evaluateStateWithDerivative(state, dt * 0.5, a); const c = this.evaluateStateWithDerivative(state, dt * 0.5, b); const d = this.evaluateStateWithDerivative(state, dt, c); const dxdt = 1 / 6 * (a.dx + 2 * (b.dx + c.dx) + d.dx); const dvdt = 1 / 6 * (a.dv + 2 * (b.dv + c.dv) + d.dv); state.x = state.x + dxdt * dt; state.v = state.v + dvdt * dt; return state; } evaluateState(initialState2) { const dv = this.accelerationForState(initialState2); return { dx: initialState2.v, dv }; } evaluateStateWithDerivative(initialState2, dt, derivative) { const state = { x: initialState2.x + derivative.dx * dt, v: initialState2.v + derivative.dv * dt }; const output = { dx: state.v, dv: this.accelerationForState(state) }; return output; } }; // ../../library/src/animation/Animators/FrictionAnimator.ts var FrictionAnimator = class { constructor(options) { this.options = { velocity: 0, friction: 2, tolerance: 1 / 10 }; Object.assign(this.options, options); this.state = { x: 0, v: this.options.velocity }; this.integrator = new Integrator((state) => -(this.options.friction * state.v)); } setFrom(value) { this.state.x = value; } setTo(value) { } setVelocity(velocity) { this.state.v = velocity; } getState() { return this.state; } isReady() { return true; } next(delta) { this.state = this.integrator.integrateState(this.state, delta); return this.state.x; } isFinished() { return Math.abs(this.state.v) < this.options.tolerance; } }; // ../../library/src/interpolation/Interpolation.ts function isInterpolatable(value) { return typeof value==="function" && value.interpolationFor && typeof value.interpolationFor==="function" ; } var Interpolation={ /** * @param from - * @param to - * @internal */ handleUndefined: (from, to)=> { if (from === void 0) { from = to; } if (to === void 0) { to = from; } return [from, to]; } }; // ../../library/src/interpolation/NumberInterpolation.ts var NumberInterpolation = { interpolate(from, to) { ; [from, to] = Interpolation.handleUndefined(from, to); const a1 = +from; const b1 = to - a1; return (progress2) => { const value = a1 + b1 * progress2; return value; }; }, difference(from, to) { return to - from; } }; // ../../library/src/animation/Animators/SpringCurveValueConverter.ts var epsilon = 1e-3; var minDuration = 0.01; var maxDuration = 10; var minDamping = Number.MIN_VALUE; var maxDamping = 1; function approximateRoot(func, derivative, initialGuess, times = 12) { let result = initialGuess; for (let i = 1, end = times, asc = 1 <=e nd; asc ? i < end : i> end; asc ? i++ : i--) { result = result - func(result) / derivative(result); } return result; } function angularFrequency(undampedFrequency, dampingRatio) { return undampedFrequency * Math.sqrt(1 - Math.pow(dampingRatio, 2)); } var SpringCurveValueConverter = { computeDampingRatio: (tension, friction, mass = 1) => { return friction / (2 * Math.sqrt(mass * tension)); }, // Tries to compute the duration of a spring, // but can't for certain velocities and if dampingRatio >= 1 // In those cases it will return null computeDuration: (tension, friction, velocity = 0, mass = 1) => { let duration; const dampingRatio = SpringCurveValueConverter.computeDampingRatio(tension, friction); const undampedFrequency = Math.sqrt(tension / mass); if (dampingRatio < 1) { const a=M ath.sqrt(1 - Math.pow(dampingRatio, 2)); const b=v elocity / (a * undampedFrequency); const c=d ampingRatio / a; const d=- ((b - c) / epsilon); if (d <=0 ) { return null; } duration=M ath.log(d) / (dampingRatio * undampedFrequency); } else { return null; } return duration; }, computeDerivedCurveOptions: (dampingRatio, duration, velocity=0 , mass=1 )=> { let derivative, envelope; dampingRatio = Math.max(Math.min(dampingRatio, maxDamping), minDamping); duration = Math.max(Math.min(duration, maxDuration), minDuration); if (dampingRatio < 1) { envelope=f unction(envelopeUndampedFrequency) { const exponentialDecay=e nvelopeUndampedFrequency * dampingRatio; const currentDisplacement=e xponentialDecay * duration; const a=e xponentialDecay - velocity; const b=a ngularFrequency(envelopeUndampedFrequency, dampingRatio); const c=M ath.exp(-currentDisplacement); return epsilon - a / b * c; }; derivative=f unction(derivativeUndampedFrequency) { const exponentialDecay=d erivativeUndampedFrequency * dampingRatio; const currentDisplacement=e xponentialDecay * duration; const d=c urrentDisplacement * velocity + velocity; const e=M ath.pow(dampingRatio, 2) * Math.pow(derivativeUndampedFrequency, 2) * duration; const f=M ath.exp(-currentDisplacement); const g=a ngularFrequency(Math.pow(derivativeUndampedFrequency, 2), dampingRatio); const factor=- envelope(derivativeUndampedFrequency) + epsilon> 0 ? -1 : 1; return factor * ((d - e) * f) / g; }; } else { envelope = function(envelopeUndampedFrequency) { const a = Math.exp(-envelopeUndampedFrequency * duration); const b = (envelopeUndampedFrequency - velocity) * duration + 1; return -epsilon + a * b; }; derivative = function(derivativeUndampedFrequency) { const a = Math.exp(-derivativeUndampedFrequency * duration); const b = (velocity - derivativeUndampedFrequency) * Math.pow(duration, 2); return a * b; }; } const result = { tension: 100, friction: 10, velocity }; const initialGuess = 5 / duration; const undampedFrequency = approximateRoot(envelope, derivative, initialGuess); if (!isNaN(undampedFrequency)) { result.tension = Math.pow(undampedFrequency, 2) * mass; result.friction = dampingRatio * 2 * Math.sqrt(mass * result.tension); } return result; } }; // ../../library/src/animation/Animators/SpringAnimator.ts var SpringTensionFrictionDefaults = { tension: 500, friction: 10, tolerance: 1 / 1e4, velocity: 0 }; var SpringDampingDurationDefaults = { dampingRatio: 1, duration: 1, velocity: 0, mass: 1 }; function isDampingDurationSpringOptions(options) { if (!options) { return false; } return typeof options.dampingRatio === "number" || typeof options.duration === "number" || typeof options.mass === "number"; } var SpringAnimator = class { constructor(options, interpolation) { this.interpolation = interpolation; let _opt; if (isDampingDurationSpringOptions(options)) { const toPass = { ...SpringDampingDurationDefaults, ...options }; _opt = SpringCurveValueConverter.computeDerivedCurveOptions( toPass.dampingRatio, toPass.duration, toPass.velocity, toPass.mass ); } else { _opt = options; } this.options = { ...SpringTensionFrictionDefaults, ..._opt }; this.state = { x: 0, v: this.options.velocity }; this.integrator = new Integrator((state) => -this.options.tension * state.x - this.options.friction * state.v); } isReady() { return this.interpolator !== void 0 && this.difference !== void 0; } next(delta) { this.state = this.integrator.integrateState(this.state, delta); const value = this.interpolator(this.progress()); return value; } isFinished() { const positionNearZero = Math.abs(this.state.x) < this.options.tolerance; const velocityNearZero=M ath.abs(this.state.v) < this.options.tolerance; return positionNearZero && velocityNearZero; } setFrom(value) { this.current=v alue; this.updateInterpolator(); } setVelocity(velocity) { this.state.v=v elocity; } progress() { return 1 - this.state.x / this.difference; } // The spring always settles to 0, so we create an interpolation to the destination // And calculate the progress based on the current state and the span of the interpolation // This lets us integrate over state.x, even though Value is generic setTo(value) { this.destination=v alue; this.difference=t his.interpolation.difference(this.destination, this.current); this.state.x=t his.difference; this.updateInterpolator(); } /** @internal */ getState() { return this.state; } updateInterpolator() { if (this.current===v oid 0 || this.destination===v oid 0) { return; } this.interpolator=t his.interpolation.interpolate(this.current, this.destination); } }; // ../../library/src/animation/Animators/InertialScrollAnimator.ts var Defaults={ velocity: 0, min: 0, max: 0, momentum: { friction: 2, tolerance: 10 }, bounce: { tension: 500, friction: 10, tolerance: 1 } }; var InertialScrollAnimator=c lass { constructor(options) { this.options=O bject.assign({ ...Defaults }, options); this.frictionAnimator=n ew FrictionAnimator({ friction: this.options.momentum.friction, tolerance: this.options.momentum.tolerance, velocity: this.options.velocity }); this.springAnimator=n ew SpringAnimator( { tension: this.options.bounce.tension, friction: this.options.bounce.friction, tolerance: this.options.bounce.tolerance, velocity: this.options.velocity }, NumberInterpolation ); this.useSpring=f alse; } isReady() { return true; } next(delta) { this.current=t his.currentAnimator.next(delta); if (!this.useSpring) { this.tryTransitionToSpring(); } return this.current; } get currentAnimator() { if (this.useSpring) { return this.springAnimator; } return this.frictionAnimator; } isFinished() { return this.currentAnimator.isFinished(); } get state() { return this.currentAnimator.getState(); } setFrom(value) { this.setState({ x: value, v: this.state.v }); } setState(state) { this.frictionAnimator.setFrom(state.x); this.frictionAnimator.setVelocity(state.v); if (this.isValidState()) { return this.tryTransitionToSpring(); } else { let bound=0 ; if (this.state.x <=t his.options.min) { bound=t his.options.min; } if (this.state.x>= this.options.max) { bound = this.options.max; } return this.transitionToSpring(bound); } } setTo(destination) { this.frictionAnimator.setTo(destination); this.springAnimator.setTo(destination); } setLimits(min, max) { this.options.min = min; this.options.max = max; } // If the position is outside the min and max bounds, and traveling // further away, then transition from friction to spring animation tryTransitionToSpring() { const belowMinWithVelocity = this.state.x < this.options.min && this.state.v <=0 ; const aboveMaxWithVelocity=t his.state.x> this.options.max && this.state.v >= 0; if (belowMinWithVelocity || aboveMaxWithVelocity) { let bound; if (belowMinWithVelocity) { bound = this.options.min; } else { bound = this.options.max; } this.transitionToSpring(bound); } else { this.useSpring = false; } } transitionToSpring(bound) { this.springAnimator.setFrom(this.state.x); this.springAnimator.setVelocity(this.state.v); this.springAnimator.setTo(bound); this.useSpring = true; } // If the position is outside the min and max bounds, but traveling // back towards the bounds, check if the velocity is sufficient to // carry the position back within bounds. If it is, let friction do the // work. If not, the state is invalid, so use the spring. isValidState() { const belowMinTravelingBack = this.state.x < this.options.min && this.state.v> 0; const aboveMaxTravelingBack = this.state.x > this.options.max && this.state.v < 0; if (belowMinTravelingBack || aboveMaxTravelingBack) { let bound; if (belowMinTravelingBack) { bound=t his.options.min; } else { bound=t his.options.max; } const friction=t his.frictionAnimator.options.friction; const solution=1 - friction * (bound - this.state.x) / this.state.v; return solution> 0; } return true; } // The math behind _isValidState: // // 1. Integrate the friction animator's acceleration to find velocity // // a = - k * v // dv/dt = - k * v // Int(dv/v) = - k * Int(dt) // ln v = - k * t + C // // => Solve for C at t = 0 // // ln v(0) = - k * 0 + C // ln v(0) = C // // => Plug C back into v(t) // // ln v = - k * t + ln v(0) // e^(ln v) = e^(- k * t) + e^(ln v(0)) // v = v(0) * e^(- k * t) // // 2. Integrate velocity to find position // // Int(v) = v(0) * Int(e^(- k * t)) // x = - v(0) * e^(-k * t) / k + C // // => Solve for C at t = 0 // // x(0) = - v(0) * e^(-k * 0) / k + C // x(0) = - v(0) / k + C // x(0) + v(0) / k = C // // => Plug C back into x(t) // // x = - v(0) * e^(-k * t) / k + x(0) + v(0) / k // // 3. Check if a (real) solution exists for t for position x // // x = - v(0) * e^(-k * t) / k + x(0) + v(0) / k // x - x(0) = - v(0) * e^(-k * t) / k + v(0) / k // k * (x - x(0)) = - v(0) * e^(-k * t) + v(0) // k * (x - x(0)) - v(0) = - v(0) * e^(-k * t) // (k * (x - x(0)) - v(0)) / - v(0) = e^(-k * t) // 1 - (k * (x - x(0)) / v(0) = e^(-k * t) // ln(1 - (k * (x - x(0)) / v(0)) = -k * t // // Therefore, a real solution exists if 1 - (k * (x - x(0)) / v(0) > 0 }; // ../../library/src/render/types/Color/converters.ts var import_hsluv = __toESM(require_hsluv(), 1); // ../../library/src/render/types/Color/CSSNames.ts var cssNames = { aliceblue: "f0f8ff", antiquewhite: "faebd7", aqua: "0ff", aquamarine: "7fffd4", azure: "f0ffff", beige: "f5f5dc", bisque: "ffe4c4", black: "000", blanchedalmond: "ffebcd", blue: "00f", blueviolet: "8a2be2", brown: "a52a2a", burlywood: "deb887", burntsienna: "ea7e5d", cadetblue: "5f9ea0", chartreuse: "7fff00", chocolate: "d2691e", coral: "ff7f50", cornflowerblue: "6495ed", cornsilk: "fff8dc", crimson: "dc143c", cyan: "0ff", darkblue: "00008b", darkcyan: "008b8b", darkgoldenrod: "b8860b", darkgray: "a9a9a9", darkgreen: "006400", darkgrey: "a9a9a9", darkkhaki: "bdb76b", darkmagenta: "8b008b", darkolivegreen: "556b2f", darkorange: "ff8c00", darkorchid: "9932cc", darkred: "8b0000", darksalmon: "e9967a", darkseagreen: "8fbc8f", darkslateblue: "483d8b", darkslategray: "2f4f4f", darkslategrey: "2f4f4f", darkturquoise: "00ced1", darkviolet: "9400d3", deeppink: "ff1493", deepskyblue: "00bfff", dimgray: "696969", dimgrey: "696969", dodgerblue: "1e90ff", firebrick: "b22222", floralwhite: "fffaf0", forestgreen: "228b22", fuchsia: "f0f", gainsboro: "dcdcdc", ghostwhite: "f8f8ff", gold: "ffd700", goldenrod: "daa520", gray: "808080", green: "008000", greenyellow: "adff2f", grey: "808080", honeydew: "f0fff0", hotpink: "ff69b4", indianred: "cd5c5c", indigo: "4b0082", ivory: "fffff0", khaki: "f0e68c", lavender: "e6e6fa", lavenderblush: "fff0f5", lawngreen: "7cfc00", lemonchiffon: "fffacd", lightblue: "add8e6", lightcoral: "f08080", lightcyan: "e0ffff", lightgoldenrodyellow: "fafad2", lightgray: "d3d3d3", lightgreen: "90ee90", lightgrey: "d3d3d3", lightpink: "ffb6c1", lightsalmon: "ffa07a", lightseagreen: "20b2aa", lightskyblue: "87cefa", lightslategray: "789", lightslategrey: "789", lightsteelblue: "b0c4de", lightyellow: "ffffe0", lime: "0f0", limegreen: "32cd32", linen: "faf0e6", magenta: "f0f", maroon: "800000", mediumaquamarine: "66cdaa", mediumblue: "0000cd", mediumorchid: "ba55d3", mediumpurple: "9370db", mediumseagreen: "3cb371", mediumslateblue: "7b68ee", mediumspringgreen: "00fa9a", mediumturquoise: "48d1cc", mediumvioletred: "c71585", midnightblue: "191970", mintcream: "f5fffa", mistyrose: "ffe4e1", moccasin: "ffe4b5", navajowhite: "ffdead", navy: "000080", oldlace: "fdf5e6", olive: "808000", olivedrab: "6b8e23", orange: "ffa500", orangered: "ff4500", orchid: "da70d6", palegoldenrod: "eee8aa", palegreen: "98fb98", paleturquoise: "afeeee", palevioletred: "db7093", papayawhip: "ffefd5", peachpuff: "ffdab9", peru: "cd853f", pink: "ffc0cb", plum: "dda0dd", powderblue: "b0e0e6", purple: "800080", rebeccapurple: "663399", red: "f00", rosybrown: "bc8f8f", royalblue: "4169e1", saddlebrown: "8b4513", salmon: "fa8072", sandybrown: "f4a460", seagreen: "2e8b57", seashell: "fff5ee", sienna: "a0522d", silver: "c0c0c0", skyblue: "87ceeb", slateblue: "6a5acd", slategray: "708090", slategrey: "708090", snow: "fffafa", springgreen: "00ff7f", steelblue: "4682b4", tan: "d2b48c", teal: "008080", thistle: "d8bfd8", tomato: "ff6347", turquoise: "40e0d0", violet: "ee82ee", wheat: "f5deb3", white: "fff", whitesmoke: "f5f5f5", yellow: "ff0", yellowgreen: "9acd32" }; // ../../library/src/render/types/Color/types.ts var ColorFormat = /* @__PURE__ */ ((ColorFormat2) => { ColorFormat2["RGB"] = "rgb"; ColorFormat2["HSL"] = "hsl"; ColorFormat2["HSV"] = "hsv"; ColorFormat2["HEX"] = "hex"; ColorFormat2["NAME"] = "name"; return ColorFormat2; })(ColorFormat || {}); var ColorMixModelType = /* @__PURE__ */ ((ColorMixModelType2) => { ColorMixModelType2["RGB"] = "rgb"; ColorMixModelType2["RGBA"] = "rgba"; ColorMixModelType2["HSL"] = "hsl"; ColorMixModelType2["HSLA"] = "hsla"; ColorMixModelType2["HUSL"] = "husl"; return ColorMixModelType2; })(ColorMixModelType || {}); // ../../library/src/render/types/Color/Utils.ts function modulate(value, rangeA, rangeB, limit = false) { const [fromLow, fromHigh] = rangeA; const [toLow, toHigh] = rangeB; const fromDelta = fromHigh - fromLow; if (fromDelta === 0) return (toHigh + toLow) / 2; const toDelta = toHigh - toLow; if (toDelta === 0) return toLow; const result = toLow + (value - fromLow) / fromDelta * toDelta; if (limit === true) { if (toLow < toHigh) { if (result < toLow) { return toLow; } if (result> toHigh) { return toHigh; } } else { if (result > toLow) { return toLow; } if (result < toHigh) { return toHigh; } } } return result; } function isNumeric(value) { return !isNaN(value) && isFinite(value); } function percentToFraction(val) { const digits=n umberFromString(val); if (digits !==v oid 0) { if (val.includes( "%")) { return digits / 100; } return digits; } return 0; } function numberFromString(input) { const match=i nput.match(/\d?\.?\d+/); return match ? Number(match[0]) : void 0; } // ../../library/src/render/types/Color/converters.ts var { hsluvToRgb, rgbToHsluv: rgbToHsluvExternal }=i mport_hsluv.default; function rgbToHsluv(r, g, b) { const [h, s, l]=r gbToHsluvExternal([r / 255, g / 255, b / 255]); return { h, s, l }; } function rgbaFromHusl(h, s, l, a=1 ) { const rgb=h sluvToRgb([h, s, l]); return { r: rgb[0] * 255, g: rgb[1] * 255, b: rgb[2] * 255, a }; } function hsvToStr(h, s, v, a) { const _h=M ath.round(h); const _s=M ath.round(s * 100); const _v=M ath.round(v * 100); return a===v oid 0 || a===1 ? "hsv(" + _h + ", " + _s + "%, " + _v + "%)" : "hsva(" + _h + ", " + _s + "%, " + _v + "%, " + a + ")"; } function rgbToRgb(r, g, b) { return { r: isNumeric(r) ? bound01(r, 255) * 255 : 0, g: isNumeric(g) ? bound01(g, 255) * 255 : 0, b: isNumeric(b) ? bound01(b, 255) * 255 : 0 }; } function rgbToHex(r, g, b, allow3Char) { const hex=[ pad2(Math.round(r).toString(16)), pad2(Math.round(g).toString(16)), pad2(Math.round(b).toString(16)) ]; if (allow3Char && hex[0].charAt(0)===h ex[0].charAt(1) && hex[1].charAt(0)===h ex[1].charAt(1) && hex[2].charAt(0)===h ex[2].charAt(1)) { return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0); } return hex.join( ""); } function rgbToHsl(r, g, b) { let l; let s; const _r=b ound01(r, 255); const _g=b ound01(g, 255); const _b=b ound01(b, 255); const max=M ath.max(_r, _g, _b); const min=M ath.min(_r, _g, _b); let h=s=l=( max + min) / 2; if (max===m in) { h=s=0 ; } else { const d=m ax - min; s=l> 0.5 ? d / (2 - max - min) : d / (max + min); switch (max) { case _r: h = (_g - _b) / d + (_g < _b ? 6 : 0); break; case _g: h=( _b - _r) / d + 2; break; case _b: h=( _r - _g) / d + 4; break; } h /=6 ; } return { h: h * 360, s, l }; } function hue2rgb(p, q, t) { if (t < 0) { t +=1 ; } if (t> 1) { t -= 1; } if (t < 1 / 6) { return p + (q - p) * 6 * t; } if (t < 1 / 2) { return q; } if (t < 2 / 3) { return p + (q - p) * (2 / 3 - t) * 6; } return p; } function hslToRgb(h, s, l) { let r; let g; let b; h=b ound01(h, 360); s=b ound01(s * 100, 100); l=b ound01(l * 100, 100); if (s===0 ) { r=g=b=l ; } else { const q=l < 0.5 ? l * (1 + s) : l + s - l * s; const p=2 * l - q; r=h ue2rgb(p, q, h + 1 / 3); g=h ue2rgb(p, q, h); b=h ue2rgb(p, q, h - 1 / 3); } return { r: r * 255, g: g * 255, b: b * 255 }; } function rgbToHsv(r, g, b) { r=b ound01(r, 255); g=b ound01(g, 255); b=b ound01(b, 255); const max=M ath.max(r, g, b); const min=M ath.min(r, g, b); const d=m ax - min; let h; const s=m ax===0 ? 0 : d / max; const v=m ax; if (max===m in) { h=0 ; } else { switch (max) { case r: h=( g - b) / d + (g < b ? 6 : 0); break; case g: h=( b - r) / d + 2; break; case b: h=( r - g) / d + 4; break; } h /=6 ; } return { h, s, v }; } function hsvToRgb(h, s, v) { h=b ound01(h, 360) * 6; s=b ound01(s * 100, 100); v=b ound01(v * 100, 100); const i=M ath.floor(h); const f=h - i; const p=v * (1 - s); const q=v * (1 - f * s); const t=v * (1 - (1 - f) * s); const mod=i % 6; const r=[ v, q, p, p, t, v][mod]; const g=[ t, v, v, q, p, p][mod]; const b=[ p, p, t, v, v, q][mod]; return { r: r * 255, g: g * 255, b: b * 255 }; } function bound01(n, max) { let _max; let _n; if (typeof max==="string" ) _max=p arseFloat(max); else _max=m ax; if (typeof n==="string" ) { if (isOnePointZero(n)) { n="100%" ; } const processPercent=i sPercentage(n); _n=M ath.min(_max, Math.max(0, parseFloat(n))); if (processPercent) { _n=M ath.floor(_n * _max) / 100; } } else { _n=n ; } if (Math.abs(_n - _max) < 1e-6) { return 1; } return _n % _max / _max; } function isOnePointZero(n) { return typeof n==="string" && n.includes( ".") && parseFloat(n)===1 ; } function isPercentage(n) { return typeof n==="string" && n.includes( "%"); } function pad2(char) { if (char.length===1 ) { return "0" + char; } else { return "" + char; } } var matchers=f unction() { const cssInteger="[-\\+]?\\d+%?" ; const cssNumber="[-\\+]?\\d*\\.\\d+%?" ; const cssUnit="(?:" + cssNumber + ")|(?:" + cssInteger + ")"; const permissiveMatch3="[\\s|\\(]+(" + cssUnit + ")[,|\\s]+(" + cssUnit + ")[,|\\s]+(" + cssUnit + ")\\s*\\)?"; const permissiveMatch4="[\\s|\\(]+(" + cssUnit + ")[,|\\s]+(" + cssUnit + ")[,|\\s]+(" + cssUnit + ")[,|\\s]+(" + cssUnit + ")\\s*\\)?"; return { rgb: new RegExp( "rgb" + permissiveMatch3), rgba: new RegExp( "rgba" + permissiveMatch4), hsl: new RegExp( "hsl" + permissiveMatch3), hsla: new RegExp( "hsla" + permissiveMatch4), hsv: new RegExp( "hsv" + permissiveMatch3), hsva: new RegExp( "hsva" + permissiveMatch4), hex3: /^([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex6: /^([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ }; }(); function stringToObject(inputColor) { var _a, _b, _c, _d, _e, _f, _g, _h, _i, _j, _k, _l, _m, _n, _o, _p, _q, _r, _s, _t, _u, _v, _w, _x, _y, _z, _A, _B; if (inputColor.includes( "gradient(")) return false; if (inputColor.includes( "var(")) return false; const trimLeft=/ ^[\s,#]+/; const trimRight=/ \s+$/; let color2=i nputColor.replace(trimLeft, "").replace(trimRight, "").toLowerCase(); let named=f alse; if (cssNames[color2]) { color2=c ssNames[color2]; named=t rue; } if (color2==="transparent" ) { return { r: 0, g: 0, b: 0, a: 0, format: "name" /* NAME */ }; } let match; if (match=m atchers.rgb.exec(color2)) { return { r: parseInt((_a=m atch[1]) !=n ull ? _a : ""), g: parseInt((_b=m atch[2]) !=n ull ? _b : ""), b: parseInt((_c=m atch[3]) !=n ull ? _c : ""), a: 1, format: "rgb" /* RGB */ }; } if (match=m atchers.rgba.exec(color2)) { return { r: parseInt((_d=m atch[1]) !=n ull ? _d : ""), g: parseInt((_e=m atch[2]) !=n ull ? _e : ""), b: parseInt((_f=m atch[3]) !=n ull ? _f : ""), a: parseFloat((_g=m atch[4]) !=n ull ? _g : ""), format: "rgb" /* RGB */ }; } if (match=m atchers.hsl.exec(color2)) { return { h: parseInt((_h=m atch[1]) !=n ull ? _h : ""), s: percentToFraction((_i=m atch[2]) !=n ull ? _i : ""), l: percentToFraction((_j=m atch[3]) !=n ull ? _j : ""), a: 1, format: "hsl" /* HSL */ }; } if (match=m atchers.hsla.exec(color2)) { return { h: parseInt((_k=m atch[1]) !=n ull ? _k : ""), s: percentToFraction((_l=m atch[2]) !=n ull ? _l : ""), l: percentToFraction((_m=m atch[3]) !=n ull ? _m : ""), a: parseFloat((_n=m atch[4]) !=n ull ? _n : ""), format: "hsl" /* HSL */ }; } if (match=m atchers.hsv.exec(color2)) { return { h: parseInt((_o=m atch[1]) !=n ull ? _o : ""), s: percentToFraction((_p=m atch[2]) !=n ull ? _p : ""), v: percentToFraction((_q=m atch[3]) !=n ull ? _q : ""), a: 1, format: "hsv" /* HSV */ }; } if (match=m atchers.hsva.exec(color2)) { return { h: parseInt((_r=m atch[1]) !=n ull ? _r : ""), s: percentToFraction((_s=m atch[2]) !=n ull ? _s : ""), v: percentToFraction((_t=m atch[3]) !=n ull ? _t : ""), a: parseFloat((_u=m atch[4]) !=n ull ? _u : ""), format: "hsv" /* HSV */ }; } if (match=m atchers.hex8.exec(color2)) { return { r: parseIntFromHex((_v=m atch[1]) !=n ull ? _v : ""), g: parseIntFromHex((_w=m atch[2]) !=n ull ? _w : ""), b: parseIntFromHex((_x=m atch[3]) !=n ull ? _x : ""), a: convertHexToDecimal((_y=m atch[4]) !=n ull ? _y : ""), format: named ? "name" /* NAME */ : "hex" /* HEX */ }; } if (match=m atchers.hex6.exec(color2)) { return { r: parseIntFromHex((_z=m atch[1]) !=n ull ? _z : ""), g: parseIntFromHex((_A=m atch[2]) !=n ull ? _A : ""), b: parseIntFromHex((_B=m atch[3]) !=n ull ? _B : ""), a: 1, format: named ? "name" /* NAME */ : "hex" /* HEX */ }; } if (match=m atchers.hex4.exec(color2)) { return { r: parseIntFromHex(`${match[1]}${match[1]}`), g: parseIntFromHex(`${match[2]}${match[2]}`), b: parseIntFromHex(`${match[3]}${match[3]}`), a: convertHexToDecimal(match[4] + "" + match[4]), format: named ? "name" /* NAME */ : "hex" /* HEX */ }; } if (match=m atchers.hex3.exec(color2)) { return { r: parseIntFromHex(`${match[1]}${match[1]}`), g: parseIntFromHex(`${match[2]}${match[2]}`), b: parseIntFromHex(`${match[3]}${match[3]}`), a: 1, format: named ? "name" /* NAME */ : "hex" /* HEX */ }; } else { return false; } } function parseIntFromHex(hex) { return parseInt(hex, 16); } function convertHexToDecimal(h) { return parseIntFromHex(h) / 255; } // ../../library/src/render/types/Color/Color.ts var cache=/ * @__PURE__ */ new Map(); var Color=/ * @__PURE__ */ (()=> { function Color2(color2, r, g, b) { if (typeof color2 === "string") { let c = cache.get(color2); if (c) return c; c = createColor(color2); if (c === void 0) return { ...Color2("black"), isValid: false }; cache.set(color2, c); return c; } const created = createColor(color2, r, g, b); return created !== void 0 ? created : { ...Color2("black"), isValid: false }; } function createColor(color2, r, g, b) { if (color2 === "") return void 0; const colorData = getCompleteColorStrategy(color2, r, g, b); if (colorData) { const newColor = { r: colorData.r, g: colorData.g, b: colorData.b, a: colorData.a, h: colorData.h, s: colorData.s, l: colorData.l, initialValue: typeof color2 === "string" && colorData.format !== "hsv" /* HSV */ ? color2 : void 0, roundA: Math.round(100 * colorData.a) / 100, format: colorData.format, mix: Color2.mix, toValue: () => Color2.toRgbString(newColor) }; return newColor; } else { return void 0; } } const ColorMixModel = { isRGB(colorModel) { return colorModel === "rgb" /* RGB */ || colorModel === "rgba" /* RGBA */; }, isHSL(colorModel) { return colorModel === "hsl" /* HSL */ || colorModel === "hsla" /* HSLA */; } }; Color2.inspect = (color2, initialValue) => { if (color2.format === "hsl" /* HSL */) { return ` <${color2.constructor.name} h:${color2.h} s:${color2.s} l:${color2.l} a:${color2.a}>`; } else if (color2.format === "hex" /* HEX */ || color2.format === "name" /* NAME */) { return ` <${color2.constructor.name} "${initialValue}">`; } else { return ` <${color2.constructor.name} r:${color2.r} g:${color2.g} b:${color2.b} a:${color2.a}>`; } }; Color2.isColor = (color2) => { if (typeof color2 === "string") { return Color2.isColorString(color2); } else { return Color2.isColorObject(color2); } }; Color2.isColorString = (colorString) => { if (typeof colorString === "string") { return stringToObject(colorString) !== false; } return false; }; Color2.isColorObject = (color2) => { return color2 && typeof color2 !== "string" && typeof color2.r === "number" && typeof color2.g === "number" && typeof color2.b === "number" && typeof color2.h === "number" && typeof color2.s === "number" && typeof color2.l === "number" && typeof color2.a === "number" && typeof color2.roundA === "number" && typeof color2.format === "string"; }; Color2.toString = (color2) => { return Color2.toRgbString(color2); }; Color2.toHex = (color2, allow3Char = false) => { return rgbToHex(color2.r, color2.g, color2.b, allow3Char); }; Color2.toHexString = (color2, allow3Char = false) => { return `#${Color2.toHex(color2, allow3Char)}`; }; Color2.toRgbString = (color2) => { return color2.a === 1 ? "rgb(" + Math.round(color2.r) + ", " + Math.round(color2.g) + ", " + Math.round(color2.b) + ")" : "rgba(" + Math.round(color2.r) + ", " + Math.round(color2.g) + ", " + Math.round(color2.b) + ", " + color2.roundA + ")"; }; Color2.toHusl = (color2) => { return { ...rgbToHsluv(color2.r, color2.g, color2.b), a: color2.roundA }; }; Color2.toHslString = (color2) => { const hsl = Color2.toHsl(color2); const h = Math.round(hsl.h); const s = Math.round(hsl.s * 100); const l = Math.round(hsl.l * 100); return color2.a === 1 ? "hsl(" + h + ", " + s + "%, " + l + "%)" : "hsla(" + h + ", " + s + "%, " + l + "%, " + color2.roundA + ")"; }; Color2.toHsv = (color2) => { const hsv = rgbToHsv(color2.r, color2.g, color2.b); return { h: hsv.h * 360, s: hsv.s, v: hsv.v, a: color2.a }; }; Color2.toHsvString = (color2) => { const hsv = rgbToHsv(color2.r, color2.g, color2.b); const h = Math.round(hsv.h * 360); const s = Math.round(hsv.s * 100); const v = Math.round(hsv.v * 100); return color2.a === 1 ? "hsv(" + h + ", " + s + "%, " + v + "%)" : "hsva(" + h + ", " + s + "%, " + v + "%, " + color2.roundA + ")"; }; Color2.toName = (color2) => { if (color2.a === 0) { return "transparent"; } if (color2.a < 1) { return false; } const hex=r gbToHex(color2.r, color2.g, color2.b, true); for (const key7 of Object.keys(cssNames)) { const value=c ssNames[key7]; if (value===h ex) { return key7; } } return false; }; Color2.toHsl=( color2)=> { return { h: Math.round(color2.h), s: color2.s, l: color2.l, a: color2.a }; }; Color2.toRgb = (color2) => { return { r: Math.round(color2.r), g: Math.round(color2.g), b: Math.round(color2.b), a: color2.a }; }; Color2.brighten = (color2, amount = 10) => { const rgb = Color2.toRgb(color2); rgb.r = Math.max(0, Math.min(255, rgb.r - Math.round(255 * -(amount / 100)))); rgb.g = Math.max(0, Math.min(255, rgb.g - Math.round(255 * -(amount / 100)))); rgb.b = Math.max(0, Math.min(255, rgb.b - Math.round(255 * -(amount / 100)))); return Color2(rgb); }; Color2.lighten = (color2, amount = 10) => { const hsl = Color2.toHsl(color2); hsl.l += amount / 100; hsl.l = Math.min(1, Math.max(0, hsl.l)); return Color2(hsl); }; Color2.darken = (color2, amount = 10) => { const hsl = Color2.toHsl(color2); hsl.l -= amount / 100; hsl.l = Math.min(1, Math.max(0, hsl.l)); return Color2(hsl); }; Color2.saturate = (color2, amount = 10) => { const hsl = Color2.toHsl(color2); hsl.s += amount / 100; hsl.s = Math.min(1, Math.max(0, hsl.s)); return Color2(hsl); }; Color2.desaturate = (color2, amount = 10) => { const hsl = Color2.toHsl(color2); hsl.s -= amount / 100; hsl.s = Math.min(1, Math.max(0, hsl.s)); return Color2(hsl); }; Color2.grayscale = (color2) => { return Color2.desaturate(color2, 100); }; Color2.hueRotate = (color2, angle) => { const hsl = Color2.toHsl(color2); hsl.h += angle; hsl.h = hsl.h > 360 ? hsl.h - 360 : hsl.h; return Color2(hsl); }; Color2.alpha = (color2, a = 1) => { return Color2({ r: color2.r, g: color2.g, b: color2.b, a }); }; Color2.transparent = (color2) => { return Color2.alpha(color2, 0); }; Color2.multiplyAlpha = (color2, alphaValue = 1) => { return Color2({ r: color2.r, g: color2.g, b: color2.b, a: color2.a * alphaValue }); }; Color2.interpolate = (colorA, colorB, model = "rgb" /* RGB */) => { if (!Color2.isColorObject(colorA) || !Color2.isColorObject(colorB)) { throw new TypeError("Both arguments for Color.interpolate must be Color objects"); } return (progress2) => { const color2 = Color2.mixAsColor(colorA, colorB, progress2, false, model); return color2; }; }; Color2.mix = (from, toColor, { model = "rgb" /* RGB */ } = {}) => { const fromColor = typeof from === "string" ? Color2(from) : from; const mixer = Color2.interpolate(fromColor, toColor, model); return (p) => Color2.toRgbString(mixer(p)); }; Color2.mixAsColor = (colorA, colorB, fraction2 = 0.5, limit = false, model = "rgb" /* RGB */) => { let result = null; if (ColorMixModel.isRGB(model)) { result = Color2({ r: modulate(fraction2, [0, 1], [colorA.r, colorB.r], limit), g: modulate(fraction2, [0, 1], [colorA.g, colorB.g], limit), b: modulate(fraction2, [0, 1], [colorA.b, colorB.b], limit), a: modulate(fraction2, [0, 1], [colorA.a, colorB.a], limit) }); } else { let hslA, hslB; if (ColorMixModel.isHSL(model)) { hslA = Color2.toHsl(colorA); hslB = Color2.toHsl(colorB); } else { hslA = Color2.toHusl(colorA); hslB = Color2.toHusl(colorB); } if (hslA.s === 0) { hslA.h = hslB.h; } else if (hslB.s === 0) { hslB.h = hslA.h; } const fromH = hslA.h; const toH = hslB.h; let deltaH = toH - fromH; if (deltaH > 180) { deltaH = toH - 360 - fromH; } else if (deltaH < -180) { deltaH=t oH + 360 - fromH; } const tween={ h: modulate(fraction2, [0, 1], [fromH, fromH + deltaH], limit), s: modulate(fraction2, [0, 1], [hslA.s, hslB.s], limit), l: modulate(fraction2, [0, 1], [hslA.l, hslB.l], limit), a: modulate(fraction2, [0, 1], [colorA.a, colorB.a], limit) }; if (ColorMixModel.isHSL(model)) { result=C olor2(tween); } else { result=C olor2(rgbaFromHusl(tween.h, tween.s, tween.l, tween.a)); } } return result; }; Color2.random=( alphaValue=1 )=> { function gen() { return Math.floor(Math.random() * 255); } return Color2("rgba(" + gen() + ", " + gen() + ", " + gen() + ", " + alphaValue + ")"); }; Color2.grey = (amount = 0.5, alphaValue = 1) => { amount = Math.floor(amount * 255); return Color2("rgba(" + amount + ", " + amount + ", " + amount + ", " + alphaValue + ")"); }; Color2.gray = Color2.grey; Color2.rgbToHsl = (r, g, b) => { return rgbToHsl(r, g, b); }; Color2.isValidColorProperty = (name, value) => { const isColorKey = name.toLowerCase().slice(-5) === "color" || name === "fill" || name === "stroke"; if (isColorKey && typeof value === "string" && Color2.isColorString(value)) { return true; } return false; }; Color2.difference = (colorA, colorB) => { const _r = (colorA.r + colorB.r) / 2; const deltaR = colorA.r - colorB.r; const deltaG = colorA.g - colorB.g; const deltaB = colorA.b - colorB.b; const deltaR2 = Math.pow(deltaR, 2); const deltaG2 = Math.pow(deltaG, 2); const deltaB2 = Math.pow(deltaB, 2); return Math.sqrt(2 * deltaR2 + 4 * deltaG2 + 3 * deltaB2 + _r * (deltaR2 - deltaB2) / 256); }; Color2.equal = (colorA, colorB, tolerance = 0.1) => { if (Math.abs(colorA.r - colorB.r) >= tolerance) { return false; } if (Math.abs(colorA.g - colorB.g) >= tolerance) { return false; } if (Math.abs(colorA.b - colorB.b) >= tolerance) { return false; } if (Math.abs(colorA.a - colorB.a) * 256 >= tolerance) { return false; } return true; }; return Color2; })(); function getCompleteColorStrategy(colorOrR, g, b, a = 1) { let completeColor; if (typeof colorOrR === "number" && !Number.isNaN(colorOrR) && typeof g === "number" && !Number.isNaN(g) && typeof b === "number" && !Number.isNaN(b)) { const _r = colorOrR; const _g = g; const _b = b; const _a = a; completeColor = getCompleteColorFromRGB({ r: _r, g: _g, b: _b, a: _a }); } else if (typeof colorOrR === "string") { completeColor = getCompleteColorFromString(colorOrR); } else if (typeof colorOrR === "object") { if (colorOrR.hasOwnProperty("r") && colorOrR.hasOwnProperty("g") && colorOrR.hasOwnProperty("b")) { completeColor = getCompleteColorFromRGB(colorOrR); } else { completeColor = getCompleteColorFromHSL(colorOrR); } } return completeColor; } function getCompleteColorFromString(color2) { const result = stringToObject(color2); if (result) { if (result.format === "hsl" /* HSL */) { return getCompleteColorFromHSL(result); } else if (result.format === "hsv" /* HSV */) { return getCompleteColorFromHSV(result); } else { return getCompleteColorFromRGB(result); } } } function getCompleteColorFromHSV(color2) { const rgb = hsvToRgb(color2.h, color2.s, color2.v); const hsl = rgbToHsl(rgb.r, rgb.g, rgb.b); return { ...hsl, ...rgb, format: "rgb" /* RGB */, a: color2.a !== void 0 ? correctAlpha(color2.a) : 1 }; } function getCompleteColorFromRGB(color2) { const rgb = rgbToRgb(color2.r, color2.g, color2.b); const hsl = rgbToHsl(rgb.r, rgb.g, rgb.b); return { ...hsl, ...rgb, format: "rgb" /* RGB */, a: color2.a !== void 0 ? correctAlpha(color2.a) : 1 }; } function getCompleteColorFromHSL(color2) { let h; let s; let l; let rgb = { r: 0, g: 0, b: 0 }; let hsl = { h: 0, s: 0, l: 0 }; h = isNumeric(color2.h) ? color2.h : 0; h = (h + 360) % 360; s = isNumeric(color2.s) ? color2.s : 1; if (typeof color2.s === "string") { s = numberFromString(color2.s); } l = isNumeric(color2.l) ? color2.l : 0.5; if (typeof color2.l === "string") { l = numberFromString(color2.l); } rgb = hslToRgb(h, s, l); hsl = { h, s, l }; return { ...rgb, ...hsl, a: color2.a === void 0 ? 1 : color2.a, format: "hsl" /* HSL */ }; } function correctAlpha(alphaValue) { alphaValue = parseFloat(alphaValue); if (alphaValue < 0) { alphaValue=0 ; } if (isNaN(alphaValue) || alphaValue> 1) { alphaValue = 1; } return alphaValue; } // ../../library/src/interpolation/ColorInterpolation.ts var ColorInterpolation = (type = "husl" /* HUSL */) => { return { interpolate(from, to) { ; [from, to] = Interpolation.handleUndefined(from, to); return Color.interpolate(Color(from), Color(to), type); }, difference(from, to) { return Color.difference(Color(from), Color(to)); } }; }; // ../../library/src/interpolation/NoInterpolation.ts var NoInterpolation = { interpolate(from, to) { ; [from, to] = Interpolation.handleUndefined(from, to); return (progress2) => { return progress2 < 0.5 ? from : to; }; }, difference(from, to) { return from===t o ? 0 : 1; } }; // ../../library/src/interpolation/ObjectInterpolation.ts var ObjectInterpolation=( valueInterpolation)=> { return { interpolate(from, to) { ; [from, to] = Interpolation.handleUndefined(from, to); const result = Object.assign({}, from); const interpolations = {}; const keys3 = /* @__PURE__ */ new Set(); for (const key7 in from) { interpolations[key7] = valueInterpolation.interpolate(from[key7], to[key7]); keys3.add(key7); } for (const key7 in to) { if (!keys3.has(key7)) { interpolations[key7] = valueInterpolation.interpolate(from[key7], to[key7]); keys3.add(key7); } } return (progress2) => { for (const key7 in interpolations) { result[key7] = interpolations[key7](progress2); } return result; }; }, difference(from, to) { let sum = 0; for (const key7 in from) { const difference = valueInterpolation.difference(from[key7], to[key7]); sum += Math.pow(difference, 2); } return Math.sqrt(sum); } }; }; // ../../library/src/interpolation/ValueInterpolation.ts var DefaultInterpolationOptions = { colorModel: "husl" /* HUSL */ }; var ValueInterpolation = class { /** * @internal */ constructor(options = DefaultInterpolationOptions) { /** * @internal */ this.interpolate = (from, to) => { ; [from, to] = Interpolation.handleUndefined(from, to); return this.interPolationForValue(from).interpolate(from, to); }; /** * @internal */ this.difference = (from, to) => { const interpolation = this.interPolationForValue(from); return interpolation.difference(from, to); }; this.options = { ...DefaultInterpolationOptions, ...options }; } /** * @internal */ interPolationForValue(value) { const type = typeof value; if (type === "number") { return NumberInterpolation; } else if (type === "boolean" || type === "function") { return NoInterpolation; } else if (Color.isColor(value)) { return ColorInterpolation(this.options.colorModel); } else if (type === "object") { if (value === null) { return NoInterpolation; } const constructor = value.constructor; if (constructor && isInterpolatable(constructor)) { const interpolation = constructor.interpolationFor(value, this); if (interpolation && interpolation !== this && interpolation.constructor !== ValueInterpolation) { return interpolation; } } return ObjectInterpolation(this); } console.warn(`No interpolation defined for ${value}`); return NoInterpolation; } }; var AnyInterpolation = /* @__PURE__ */ new ValueInterpolation(); // ../../library/src/animation/Animators/PrecalculatedAnimator.ts var Defaults2 = { delta: 1 / 60, maxValues: 1e4 }; var PrecalculatedAnimator = class { constructor(options) { this.currentTime = 0; this.options = { ...Defaults2, ...options }; this.animator = options.animator; } preCalculate() { if (!this.animator.isReady()) { return; } const { delta } = this.options; this.values = []; while (!this.animator.isFinished() && this.values.length < this.options.maxValues) { let value=t his.animator.next(this.options.delta); if (typeof value==="object" && value) { const object=v alue; const copy={ ...object }; value=c opy; } this.values.push(value); } this.totalTime=t his.values.length * delta; } indexForTime(time2) { return Math.max( 0, Math.min(this.values.length - 1, Math.round(this.values.length * (time2 / this.totalTime)) - 1) ); } valueForTime(time2) { const index=t his.indexForTime(time2); const value=t his.values[index]; return value; } setFrom(value) { this.animator.setFrom(value); this.preCalculate(); } setTo(end) { this.animator.setTo(end); this.preCalculate(); } isReady() { return this.values !==v oid 0 && this.values.length> 0 && this.totalTime > 0; } next(delta) { this.currentTime += delta; return this.valueForTime(this.currentTime); } isFinished() { return this.totalTime === 0 || this.currentTime >= this.totalTime; } get endValue() { this.preCalculate(); const value = this.valueForTime(this.totalTime); return this.values.length > 0 ? value : this.animator.next(0); } }; // ../../library/src/utils/safeWindow.ts var mockWindow = { addEventListener: () => { }, removeEventListener: () => { }, dispatchEvent: () => false, ResizeObserver: void 0, onpointerdown: false, onpointermove: false, onpointerup: false, ontouchstart: false, ontouchmove: false, ontouchend: false, onmousedown: false, onmousemove: false, onmouseup: false, devicePixelRatio: 1, scrollX: 0, scrollY: 0, location: { href: "" }, setTimeout: () => 0, clearTimeout: () => { }, setInterval: () => 0, clearInterval: () => { }, requestAnimationFrame: () => 0, cancelAnimationFrame: () => { }, getSelection: () => null, matchMedia: (query) => { return { matches: false, media: query, onchange: () => { }, addEventListener: () => { }, removeEventListener: () => { }, addListener: () => { }, removeListener: () => { }, dispatchEvent: () => false }; }, innerHeight: 0, SVGSVGElement: {} }; var safeWindow = typeof window === "undefined" ? mockWindow : window; // ../../library/src/core/Time.ts var _raf = (f) => { setTimeout(f, 1 / 60); }; var __raf = safeWindow["requestAnimationFrame"] || _raf; var raf = (f) => __raf(f); // ../../library/src/core/EventEmitter.ts var import_eventemitter3 = __toESM(require_eventemitter3(), 1); var { EventEmitter: EventEmitter3 } = import_eventemitter3.default; var EventEmitter = class { constructor() { this._emitter = new EventEmitter3(); } eventNames() { return this._emitter.eventNames(); } eventListeners() { const listeners = {}; for (const eventName of this._emitter.eventNames()) { listeners[eventName] = this._emitter.listeners(eventName); } return listeners; } on(eventName, fn) { this.addEventListener(eventName, fn, false, false, this); } off(eventName, fn) { this.removeEventListeners(eventName, fn); } once(eventName, fn) { this.addEventListener(eventName, fn, true, false, this); } unique(eventName, fn) { this.addEventListener(eventName, fn, false, true, this); } addEventListener(eventName, fn, once, unique, context) { if (unique) { for (const name of this._emitter.eventNames()) { if (fn === this._emitter.listeners(name)) { return; } } } if (once === true) { this._emitter.once(eventName, fn, context); } else { this._emitter.addListener(eventName, fn, context); } } removeEventListeners(eventName, fn) { if (eventName) { this._emitter.removeListener(eventName, fn); } else { this.removeAllEventListeners(); } } removeAllEventListeners() { this._emitter.removeAllListeners(); } countEventListeners(eventName, handler) { if (eventName) { return this._emitter.listeners(eventName).length; } else { let count = 0; for (const name of this._emitter.eventNames()) { count += this._emitter.listeners(name).length; } return count; } } emit(eventName, ...args) { this._emitter.emit(eventName, ...args); } }; // ../../library/src/core/Loop.ts var LoopTimeStep = 1 / 60; var Loop = class extends EventEmitter { /** * @internal */ constructor(start = false) { super(); this._started = false; this._frame = 0; this._frameTasks = []; /** * @internal */ this.tick = () => { if (!this._started) return; raf(this.tick); this.emit("update", this._frame, LoopTimeStep); this.emit("render", this._frame, LoopTimeStep); this._processFrameTasks(); this._frame++; }; if (start) { this.start(); } } /** * To add a task to be done at the end of a frame. * Tasks added from a task will be ignored. These will run after loop events have been processed. * @internal */ addFrameTask(task) { this._frameTasks.push(task); } _processFrameTasks() { var _a; const postEventTasks = this._frameTasks; const length = postEventTasks.length; if (length === 0) return; for (let i = 0; i < length; i++) { (_a=p ostEventTasks[i])==n ull ? void 0 : _a.call(postEventTasks); } postEventTasks.length=0 ; } /** * @internal */ static set TimeStep(value) { LoopTimeStep=v alue; } /** * @internal */ static get TimeStep() { return LoopTimeStep; } /** * @internal */ start() { if (this._started) return this; this._frame=0 ; this._started=t rue; raf(this.tick); return this; } /** * @internal * @deprecated Don’t use `stop` as you could be stopping the MainLoop for others. */ stop() { this._started=f alse; return this; } /** * @internal */ get frame() { return this._frame; } /** * @internal */ get time() { return this._frame * LoopTimeStep; } }; var MainLoop=n ew Loop(); // ../../library/src/render/types/RenderEnvironment.ts var RenderTarget=/ * @__PURE__ */ ((RenderTarget2)=> { RenderTarget2["canvas"] = "CANVAS"; RenderTarget2["export"] = "EXPORT"; RenderTarget2["thumbnail"] = "THUMBNAIL"; RenderTarget2["preview"] = "PREVIEW"; return RenderTarget2; })(RenderTarget || {}); var RenderEnvironment = { imageBaseURL: "", target: "PREVIEW" /* preview */, zoom: 1 }; function executeInRenderEnvironment(customEnvironment, task) { const previousEnvironment = Object.assign({}, RenderEnvironment); Object.assign(RenderEnvironment, customEnvironment); const result = task(); Object.assign(RenderEnvironment, previousEnvironment); return result; } function setGlobalRenderEnvironment(environment2) { Object.assign(RenderEnvironment, environment2); } function useRenderEnvironment(target, imageBaseURL, zoom) { let willChangeElements = false; if (RenderEnvironment.imageBaseURL !== imageBaseURL) { RenderEnvironment.imageBaseURL = imageBaseURL; willChangeElements = true; } if (RenderEnvironment.target !== target) { RenderEnvironment.target = target; willChangeElements = true; } if (RenderEnvironment.zoom !== zoom) { RenderEnvironment.zoom = zoom; } return { willChangeElements }; } ((RenderTarget2) => { function current() { return RenderEnvironment.target; } RenderTarget2.current = current; function hasRestrictions() { const target = RenderEnvironment.target; if (target === "CANVAS" /* canvas */) return true; if (target === "EXPORT" /* export */) return true; return false; } RenderTarget2.hasRestrictions = hasRestrictions; })(RenderTarget || (RenderTarget = {})); // ../../library/src/animation/Drivers/AnimationDriver.ts var AnimationDriver = class { constructor(animator, updateCallback, finishedCallback) { this.animator = animator; this.updateCallback = updateCallback; this.finishedCallback = finishedCallback; this.update = (frame, elapsed) => { if (this.animator.isFinished()) { this.finish(); } else { const value = this.animator.next(elapsed); this.updateCallback(value); } }; if (!this.animator.isReady()) { console.warn("AnimationDriver initialized with animator that isn't ready"); } } finish() { if (this.finishedCallback) { this.finishedCallback(this.animator.isFinished()); } } isFinished() { return this.animator.isFinished(); } }; // ../../library/src/animation/Drivers/MainLoopDriver.ts var MainLoopAnimationDriver = class extends AnimationDriver { play() { if (RenderEnvironment.target !== "PREVIEW" /* preview */) { this.finishedCallback && this.finishedCallback(false); return; } MainLoop.on("update", this.update); } cancel() { MainLoop.off("update", this.update); } finish() { MainLoop.off("update", this.update); super.finish(); } }; // ../../library/src/animation/FramerAnimation.ts var DefaultDeprecatedAnimationOptions = { precalculate: false, colorModel: "husl" /* HUSL */ }; var FramerAnimation = class { /** * @internal */ constructor(target, from, to, animatorClass, options, driverClass = MainLoopAnimationDriver) { /** * @internal */ this.playStateSource = "idle"; /** * @internal */ this.readyPromise = Promise.resolve(); this.resetFinishedPromise(); const deprecatedAnimationOptions = { ...DefaultDeprecatedAnimationOptions }; const animatorOptions = {}; if (options) { Object.assign(deprecatedAnimationOptions, options); Object.assign(animatorOptions, options); } let interpolation; if (deprecatedAnimationOptions.customInterpolation) { interpolation = deprecatedAnimationOptions.customInterpolation; } else { interpolation = new ValueInterpolation(options); } let animator; if (!animatorClass) { animator = new BezierAnimator({}, interpolation); } else { animator = new animatorClass(animatorOptions, interpolation); } if (deprecatedAnimationOptions.precalculate) { animator = new PrecalculatedAnimator({ animator }); } animator.setFrom(from); animator.setTo(to); const updateCallback = (value) => { FramerAnimation.driverCallbackHandler(target, value); }; const finishedCallback = (isFinished) => { if (isFinished) { FramerAnimation.driverCallbackHandler(target, to); if (this.playStateSource === "running") { this.playStateValue = "finished"; } } }; this.driver = new driverClass(animator, updateCallback, finishedCallback); } /** * @internal */ static driverCallbackHandler(target, value) { if (isAnimatable(target) || isMotionValue2(target)) { target.set(value); } else { const targetObject = target; Animatable.transaction((update) => { for (const key7 in targetObject) { const targetValue = targetObject[key7]; if (isAnimatable(targetValue)) { update(targetValue, value[key7]); } else { targetObject[key7] = value[key7]; } } }); } } /** * @internal */ get playStateValue() { return this.playStateSource; } /** * @internal */ set playStateValue(value) { if (value !== this.playStateSource) { const oldValue = value; this.playStateSource = value; switch (value) { case "idle": if (oldValue === "running") { this.oncancel && this.oncancel(); } this.readyResolve && this.readyResolve(); this.resetReadyPromise(); break; case "finished": if (oldValue === "idle") { console.warn("Bad state transition"); break; } this.onfinish && this.onfinish(); this.finishedResolve && this.finishedResolve(); break; case "running": this.resetReadyPromise(); break; } if (oldValue === "finished") { this.resetFinishedPromise(); } if (value === "finished") { this.playStateValue = "idle"; } } } /** * @internal */ get playState() { return this.playStateValue; } /** * @internal */ resetReadyPromise() { this.readyResolve = null; this.readyPromise = new Promise((resolve, reject) => { this.readyResolve = resolve; }); } /** * Wait for the animation to be ready to play. * @remarks * ```jsx * const animation = animate.ease(value, 100) * animation.ready().then(() => { * // Animation is ready * }) * // async/await syntax * const animation = animate.ease(value, 100) * await animation.ready() * // Animation is ready * ``` * @returns Promise that is resolved when the animation is ready to play * @public */ get ready() { return this.readyPromise; } /** * @internal */ resetFinishedPromise() { this.finishedResolve = null; this.finishedReject = null; this.finishedPromise = new Promise((resolve, reject) => { this.finishedResolve = resolve; this.finishedReject = reject; }); this.finishedPromise.catch((reason) => { }); } /** * Wait for the animation to be finished. * @remarks * ```jsx * // async/await syntax * const animation = animate.ease(value, 100) * await animation.finished() * // Animation is finished * * * const animation = animate.ease(value, 100) * animation.ready().then(() => { * // Animation is finished * }) * ``` * @returns Promise that is resolved when the animation is ready to play * @public */ get finished() { return this.finishedPromise; } /** * @internal */ play() { this.playStateValue = "running"; this.driver.play(); } /** * Cancels the animation if it is still running. * @remarks * ```jsx * const animation = animate.ease(value, 100, {duration: 3}) * setTimeout(() => animation.cancel(), 500) * ``` * @public */ cancel() { if (this.playStateValue !== "running") { return; } this.driver.cancel(); if (this.playState !== "idle") { const reason = "AbortError"; this.finishedReject && this.finishedReject(reason); } this.playStateValue = "idle"; } /** * @internal */ finish() { if (this.playStateSource === "running") { this.playStateValue = "finished"; this.driver.finish(); } } /** * @internal */ isFinished() { return this.playStateValue === "finished"; } }; // ../../library/src/animation/animate.ts function deprecatedAnimate(from, to, animator, options) { deprecationWarning("animate()", "2.0.0", "the new animation API (https://www.framer.com/api/animation/)"); const target = from; let fromValue; if (isAnimatable(from) || isMotionValue2(from)) { fromValue = from.get(); } else { fromValue = Animatable.objectToValues(from); } const animation = new FramerAnimation(target, fromValue, to, animator, options); animation.play(); return animation; } var animate2 = /* @__PURE__ */ (() => { function animate3(from, to, animatorOrTransition, options) { return isAnimatable(from) ? deprecatedAnimate(from, to, animatorOrTransition, options) : animate(from, to, animatorOrTransition); } animate3.spring = (from, to, options) => { return animate3(from, to, SpringAnimator, options); }; animate3.bezier = (from, to, options) => { return animate3(from, to, BezierAnimator, options); }; animate3.linear = (from, to, options) => { return animate3.bezier(from, to, { ...options, curve: "linear" /* Linear */ }); }; animate3.ease = (from, to, options) => { return animate3.bezier(from, to, { ...options, curve: "ease" /* Ease */ }); }; animate3.easeIn = (from, to, options) => { return animate3.bezier(from, to, { ...options, curve: "ease-in" /* EaseIn */ }); }; animate3.easeOut = (from, to, options) => { return animate3.bezier(from, to, { ...options, curve: "ease-out" /* EaseOut */ }); }; animate3.easeInOut = (from, to, options) => { return animate3.bezier(from, to, { ...options, curve: "ease-in-out" /* EaseInOut */ }); }; return animate3; })(); // ../../library/src/animation/Motion/MotionSetup.tsx import React13 from "react"; // ../../library/src/animation/Motion/autoValueHandlers.ts var correctBorderScale = (axis) => ({ correct: (latest, { delta, treeScale }) => { if (typeof latest === "string") latest = parseFloat(latest); if (latest === 0) return "0px"; let corrected = latest; if (delta && treeScale) { corrected = Math.round(latest / delta[axis].scale / treeScale[axis]); corrected = Math.max(corrected, 1); } return corrected + "px"; } }); // ../../library/src/animation/Motion/MotionSetup.tsx addScaleCorrector({ borderTopWidth: correctBorderScale("y"), borderLeftWidth: correctBorderScale("x"), borderRightWidth: correctBorderScale("x"), borderBottomWidth: correctBorderScale("y") }); function MotionSetup({ children }) { return /* @__PURE__ */ React13.createElement(React13.Fragment, null, children); } // ../../library/src/animation/Motion/startAnimation.ts function startAnimation(_key, value, target, transition = {}) { warnOnce( `"startAnimation" is unsupported. Use "animate" instead: https://www.framer.com/api/motion/utilities/#animate` ); return new Promise((resolve) => { animate(value, target, { ...transition, onComplete: () => resolve() }); }); } // ../../library/src/components/AnimateLayout/LayoutIdContext.tsx import React14, { useCallback, useContext as useContext2, useMemo, useRef } from "react"; // ../../library/src/utils/assert.ts function assert(condition, ...msg2) { var _a, _b; if (condition) return; const e = Error("Assertion Error" + (msg2.length > 0 ? ": " + msg2.join(" ") : "")); if (e.stack) { try { const lines = e.stack.split("\n"); if ((_a = lines[1]) == null ? void 0 : _a.includes("assert")) { lines.splice(1, 1); e.stack = lines.join("\n"); } else if ((_b = lines[0]) == null ? void 0 : _b.includes("assert")) { lines.splice(0, 1); e.stack = lines.join("\n"); } } catch { } } throw e; } function assertNever(x, error) { throw error || new Error(x ? `Unexpected value: ${x}` : "Application entered invalid state"); } // ../../library/src/components/AnimateLayout/LayoutIdContext.tsx var LayoutIdContext = React14.createContext({ getLayoutId: (args) => null, persistLayoutIdCache: () => { }, top: false, enabled: true }); function LayoutIdProvider({ children }) { const context = useContext2(LayoutIdContext); if (context.top) return /* @__PURE__ */ React14.createElement(React14.Fragment, null, children); const cache3 = useRef({ // When we provide a layoutId for a node based on it's first // duplicatedFrom id, we save it's layoutId mapped to it's actual id. // Future screen's nodes will check this cache first, to see if they've // previously been assigned a layoutId, or if any of there other // duplicatedFrom ids matched a node that was previously assigned a // layoutId. byId: {}, byName: {}, // When we navigate from screens that were duplicated from a future // screen, to that future screen, we want to do a reverse lookup on the // last duplicatedFrom id, rather than the id. We need to keep them // separate so they don't overlap. byLastId: {}, byPossibleId: {}, byLastName: {}, byLayoutId: {}, // When we don't have a cached layoutId for all duplicatedFrom ids, we // need to increment and save it so that we don't create clashing // layoutIds. We also need to reset name counts between screens, so we // record those separately. count: { byId: {}, byName: {} } }); const screen = useRef({ byId: {}, byName: {}, byLastId: {}, byPossibleId: {}, byLastName: {}, byLayoutId: {} }); const usedIds = useRef(/* @__PURE__ */ new Set()).current; const getLayoutId = useCallback(({ id, name, duplicatedFrom }) => { if (!id) return null; const cacheKey = name ? "byName" : "byId"; const previousId = cache3.current[cacheKey][id]; if (previousId) return previousId; const nodeIdentifier = name || id; if (!duplicatedFrom && !usedIds.has(nodeIdentifier) && (!cache3.current.byLayoutId[nodeIdentifier] || cache3.current.byLayoutId[nodeIdentifier] === nodeIdentifier)) { if (cache3.current.count[cacheKey][nodeIdentifier] === void 0) { cache3.current.count[cacheKey][nodeIdentifier] = 0; cache3.current.byLayoutId[nodeIdentifier] = nodeIdentifier; screen.current[cacheKey][id] = nodeIdentifier; } usedIds.add(nodeIdentifier); return nodeIdentifier; } let possibleMatch = void 0; if (duplicatedFrom == null ? void 0 : duplicatedFrom.length) { for (let index = duplicatedFrom.length - 1; index >= 0; index--) { const duplicatedId = duplicatedFrom[index]; assert(!!duplicatedId, `duplicatedId must be defined`); const match = cache3.current[cacheKey][duplicatedId]; const byLastIdMatch = cache3.current.byLastId[duplicatedId]; if (byLastIdMatch && !possibleMatch) { const matchedLayoutId = cache3.current.byLayoutId[byLastIdMatch]; const shouldUseNamedLastIdMatch = !matchedLayoutId || matchedLayoutId === name; if (byLastIdMatch && !usedIds.has(byLastIdMatch) && (name ? shouldUseNamedLastIdMatch : true)) { possibleMatch = [byLastIdMatch, duplicatedId]; } } const previousLayoutId = cache3.current.byLayoutId[match]; const shouldUseNamedMatch = !previousLayoutId || previousLayoutId === name; if (match && !usedIds.has(match) && (name ? shouldUseNamedMatch : true)) { screen.current[cacheKey][id] = match; screen.current.byLastId[duplicatedId] = match; usedIds.add(match); return match; } } } const last = cache3.current.byLastId[id]; if (last && !usedIds.has(last)) { usedIds.add(last); screen.current.byId[id] = last; return last; } if (possibleMatch) { const [match, duplicatedId] = possibleMatch; screen.current[cacheKey][id] = match; screen.current.byLastId[duplicatedId] = match; usedIds.add(match); return match; } const possible = cache3.current.byPossibleId[id]; if (possible && !usedIds.has(possible)) { usedIds.add(possible); screen.current.byId[id] = possible; return possible; } const rootDuplicatedId = duplicatedFrom == null ? void 0 : duplicatedFrom[0]; const identifier = name || rootDuplicatedId || id; const value = cache3.current.count[cacheKey][identifier] + 1 || 0; const { layoutId, value: nextValue } = nextLayoutId(identifier, value, usedIds); cache3.current.count[cacheKey][identifier] = nextValue; screen.current[cacheKey][id] = layoutId; if (duplicatedFrom == null ? void 0 : duplicatedFrom.length) { if (!name) { const lastId = duplicatedFrom[duplicatedFrom.length - 1]; if (lastId) { screen.current.byLastId[lastId] = layoutId; } if (duplicatedFrom.length > 1) { for (let index = 0; index < duplicatedFrom.length - 1; index++) { const possibleId=d uplicatedFrom[index]; if (possibleId===v oid 0) continue; if (!screen.current.byPossibleId[possibleId]) { screen.current.byPossibleId[possibleId]=l ayoutId; } } } } } screen.current.byLayoutId[layoutId]=n odeIdentifier; usedIds.add(layoutId); return layoutId; }, []); const persistLayoutIdCache=u seCallback(()=> { cache3.current = { byId: { ...cache3.current.byId, ...screen.current.byId }, byLastId: { ...cache3.current.byLastId, ...screen.current.byLastId }, byPossibleId: { ...cache3.current.byPossibleId, ...screen.current.byPossibleId }, byName: { ...cache3.current.byName, ...screen.current.byName }, byLastName: { ...cache3.current.byLastName, ...screen.current.byLastName }, byLayoutId: { ...cache3.current.byLayoutId, ...screen.current.byLayoutId }, // Unlike the count.byId, we need to reset the count.byName because // named layers might not have duplicatedFrom ids (e.g. imported // from Figma). When we can use duplicatedFrom ids to check if an id // was assigned on a previous screen, we don't increment the count, // which means that the count only increments for new items, and // only increments on a new screen if the node is new. Since named // layers need to always match in some way between screens, we reset // the count so that the second named layer on a second screen is // always name-1 if it doesn't have any duplicatedFrom ids. count: { ...cache3.current.count, byName: {} } }; screen.current = { byId: {}, byName: {}, byLastId: {}, byPossibleId: {}, byLastName: {}, byLayoutId: {} }; usedIds.clear(); }, []); const contextValue = useRef({ getLayoutId, persistLayoutIdCache, top: true, enabled: true }).current; return /* @__PURE__ */ React14.createElement(LayoutIdContext.Provider, { value: contextValue }, children); } function nextLayoutId(identifier, initialValue, usedIds) { let value = initialValue; let layoutId = value ? `${identifier}-${value}` : identifier; while (usedIds.has(layoutId)) { value++; layoutId = `${identifier}-${value}`; } return { layoutId, value }; } function AutomaticLayoutIds({ enabled = true, ...props }) { const context = useContext2(LayoutIdContext); const contextValue = useMemo(() => { return { ...context, enabled }; }, [enabled]); return /* @__PURE__ */ React14.createElement(LayoutIdContext.Provider, { ...props, value: contextValue }); } // ../../library/src/components/Device/Device.tsx import React16, { Component as Component2 } from "react"; // ../../library/src/components/utils/useConstant.ts import { useRef as useRef2 } from "react"; function useConstant(init) { const ref = useRef2(null); if (ref.current === null) { ref.current = init(); } return ref.current; } // ../../library/src/components/Device/ErrorPlaceholder.tsx import React15 from "react"; var baseStyle = { background: void 0, display: "flex", flexDirection: "column", justifyContent: "center", alignItems: "center", lineHeight: "1.4em", textOverflow: "ellipsis", overflow: "hidden", minHeight: 0, width: "100%", height: "100%" }; var errorStyle = { ...baseStyle, border: "1px solid rgba(149, 149, 149, 0.15)", borderRadius: 6, fontSize: "12px", backgroundColor: "rgba(149, 149, 149, 0.1)", color: "#a5a5a5" }; var textStyle = { overflow: "hidden", whiteSpace: "nowrap", textOverflow: "ellipsis", maxWidth: "100%", flexShrink: 0, padding: `0 10px` }; var titleStyle = { ...textStyle, // TODO: Use Fresco tokens for this. fontWeight: 500 }; var messageStyle = { ...textStyle, whiteSpace: "pre", maxHeight: "calc(50% - calc(20px * var(--framerInternalCanvas-canvasPlaceholderContentScaleFactor, 1)))", WebkitMaskImage: "linear-gradient(to bottom, black 80%, transparent 100%)" }; function ErrorPlaceholder(props) { const { error, file } = props; const title = file ? `Error in ${stripSlash(file)}` : "Error"; const message = error instanceof Error ? error.message : "" + error; return /* @__PURE__ */ React15.createElement("div", { style: errorStyle }, /* @__PURE__ */ React15.createElement("div", { className: "text", style: titleStyle }, title), message && /* @__PURE__ */ React15.createElement("div", { className: "text", style: messageStyle }, message)); } function stripSlash(title) { if (title.startsWith("./")) { return title.replace("./", ""); } return title; } // ../../library/src/components/Device/Device.tsx function getScaleData(deviceOptions, containerSize) { const { componentWidth, componentHeight } = getComponentSize(deviceOptions); const scaleX = containerSize.width / componentWidth; const scaleY = containerSize.height / componentHeight; const scale = Math.min(scaleX, scaleY, 1); let screenScalePixelFix = 1; if (scale < 1) { const actualScreenWidth=d eviceOptions.screenWidth * scale; const desiredScreenWidth=a ctualScreenWidth + 1; const screenScaleX=d esiredScreenWidth / actualScreenWidth; const actualScreenHeight=d eviceOptions.screenHeight * scale; const desiredScreenHeight=a ctualScreenHeight + 1; const screenScaleY=d esiredScreenHeight / actualScreenHeight; const screenScale=M ath.max(screenScaleX, screenScaleY); screenScalePixelFix=s creenScale; } return { scale, screenScalePixelFix, scaledComponentWidth: componentWidth * scale, scaledComponentHeight: componentHeight * scale, scaledDeviceWidth: deviceOptions.deviceWidth * scale, scaledDeviceHeight: deviceOptions.deviceHeight * scale }; } function getColorsFromTheme(theme, type) { if (type==="none" ) return {}; if (!theme) return {}; const isDarkTheme=t heme==="dark" ; return { shadowColor: isDarkTheme ? "rgba(0, 0, 0, 0.55)" : "rgba(0, 0, 0, 0.15)", bezelColor: isDarkTheme ? "#222" : "#fff", bezelShadeColor: isDarkTheme ? "#000" : "rgba(0, 0, 0, 0.2)", screenColor: isDarkTheme ? "#333" : "#eee" }; } var ErrorBoundary2=c lass extends Component2 { constructor() { super(...arguments); this.state={ }; } componentDidCatch(error, info) { let stack=i nfo.componentStack.split( "\n").filter((line)=> line.length !== 0); let currentIndex = 0; for (const line of stack) { if (line.startsWith(` in ${this.constructor.name}`)) { break; } currentIndex++; } stack = stack.slice(0, currentIndex); this.setState({ lastError: { error, componentStack: stack } }); } componentDidUpdate(_, prevState) { if (this.state.lastError === void 0) return; if (prevState.lastError === this.state.lastError) this.setState({ lastError: void 0 }); } render() { if (this.state.lastError) { return /* @__PURE__ */ React16.createElement(ErrorPlaceholder, { error: this.state.lastError.error.message, file: "Prototype" }); } return this.props.children; } }; function Device({ canResize = false, children, ResizeObserver: ResizeObserver2 = safeWindow.ResizeObserver, ...options }) { var _a; const optionsRef = React16.useRef(void 0); if (optionsRef.current === void 0) optionsRef.current = options; const deviceAppearance = (_a = options.deviceOptions) == null ? void 0 : _a.appearance.type; const scaleDataRef = React16.useRef(); const containerRef = React16.useRef(null); const deviceRef = React16.useRef(null); const screenRef = React16.useRef(null); const updateImperativeScale = ({ scale, screenScalePixelFix }) => { if (!scaleDataRef.current || !deviceRef.current || !screenRef.current) return; deviceRef.current.style.transform = `scale(${scale})`; screenRef.current.style.transform = `scale(${screenScalePixelFix})`; }; if (scaleDataRef.current === void 0 && options.deviceOptions && options.scaleTo && options.scaleTo !== "dynamic") { const scale = scaleDataRef.current = getScaleData(options.deviceOptions, options.scaleTo); updateImperativeScale(scale); } const invertScale = React16.useCallback( (point) => { if (!scaleDataRef.current) return point; const { scale = 1 } = scaleDataRef.current; return { x: point.x / scale, y: point.y / scale }; }, [scaleDataRef] ); const updateScale = React16.useCallback(() => { var _a2; const { deviceOptions, scaleTo, onScaleChange } = (_a2 = optionsRef.current) != null ? _a2 : {}; if (!deviceOptions || !scaleTo || scaleTo !== "dynamic" || !containerRef.current) return; if (containerRef.current.offsetWidth === 0 || containerRef.current.offsetHeight === 0) return; const scaleData = scaleDataRef.current = getScaleData(deviceOptions, { width: containerRef.current.offsetWidth, height: containerRef.current.offsetHeight }); onScaleChange == null ? void 0 : onScaleChange(scaleData); updateImperativeScale(scaleData); }, []); const observer = useConstant(() => { if (!ResizeObserver2) { return; } return new ResizeObserver2(() => updateScale()); }); React16.useLayoutEffect(() => { optionsRef.current = { deviceOptions: options.deviceOptions, onScaleChange: options.onScaleChange, overrideTheme: options.overrideTheme, scaleTo: options.scaleTo }; }, [options.deviceOptions, options.onScaleChange, options.overrideTheme, options.scaleTo]); React16.useLayoutEffect(() => { updateScale(); }, [updateScale]); React16.useEffect(() => { if (!observer || !containerRef.current) return; observer.observe(containerRef.current); return () => observer.disconnect(); }, [observer]); const { containerStyle, handStyle, deviceStyle, deviceImageStyle, screenStyle } = getDeviceStyle(options); const resizeStyles = canResize ? { display: "flex", justifyContent: "center", alignItems: "center", height: "100%" } : {}; return /* @__PURE__ */ React16.createElement("div", { style: { ...containerStyle, ...resizeStyles }, ref: containerRef }, /* @__PURE__ */ React16.createElement("div", { style: { ...deviceStyle }, ref: deviceRef }, handStyle && /* @__PURE__ */ React16.createElement("div", { style: handStyle }), deviceAppearance === "external-clay" && deviceImageStyle && /* @__PURE__ */ React16.createElement("div", { style: deviceImageStyle }), /* @__PURE__ */ React16.createElement( "div", { style: { ...screenStyle, pointerEvents: void 0, backgroundColor: children ? "white" : screenStyle.backgroundColor }, ref: screenRef }, /* @__PURE__ */ React16.createElement(MotionConfig, { transformPagePoint: invertScale }, /* @__PURE__ */ React16.createElement(ErrorBoundary2, null, children)) ), deviceAppearance === "realistic" && deviceImageStyle && /* @__PURE__ */ React16.createElement("div", { style: deviceImageStyle }))); } var DEVICE_PADDING = 45; var HAND_IMG_WIDTH = 2400; var HAND_IMG_HEIGHT = 3740; var HAND_IMG_GAP_WIDTH = 859; var HAND_IMG_GAP_LEFT = 772; var HAND_IMG_GAP_BOTTOM = 992 - 5; var noDeviceSize = { componentWidth: 500, componentHeight: 500 }; function getComponentSize(options) { if (!options) return noDeviceSize; const { deviceWidth, deviceHeight, noPadding } = options; const padding = noPadding ? 0 : DEVICE_PADDING * 2; return { componentWidth: deviceWidth + padding, componentHeight: deviceHeight + padding }; } function getDeviceStyle({ scaleTo, deviceOptions, overrideTheme } = {}) { var _a, _b, _c; const noDeviceStyle = { containerStyle: {}, deviceStyle: {}, screenStyle: {} }; if (!deviceOptions) return noDeviceStyle; const { componentWidth, componentHeight } = getComponentSize(deviceOptions); const overriddenColors = getColorsFromTheme(overrideTheme, deviceOptions.appearance.type); const { deviceWidth, deviceHeight, appearance, screenWidth, screenHeight, screenMaxHeight, screenOffsetTop, screenOffsetLeft, screenRadius, screenMaskImage, screenColor, shadow, background, hand } = deviceOptions; const boxShadows = []; if (appearance.type === "clay" && shadow) { boxShadows.push(shadow); } let bezelStyle = void 0; if (appearance.type === "clay") { bezelStyle = { borderRadius: appearance.bezelRadius, backgroundColor: overriddenColors.bezelColor || appearance.bezelColor }; if (overriddenColors.bezelShadeColor || appearance.bezelShadeColor) { boxShadows.push(`inset 0 0 15px ${overriddenColors.bezelShadeColor || appearance.bezelShadeColor}`); } } const handOffsetLeft = (_a = hand == null ? void 0 : hand.offsetLeft) != null ? _a : 0; const handOffsetRight = (_b = hand == null ? void 0 : hand.offsetRight) != null ? _b : 0; const handOffsetBottom = (_c = hand == null ? void 0 : hand.offsetBottom) != null ? _c : 0; const handScale = (deviceWidth - handOffsetLeft - handOffsetRight) / HAND_IMG_GAP_WIDTH; return { containerStyle: { width: scaleTo ? "100%" : componentWidth, height: scaleTo ? "100%" : componentHeight, flex: "1 1 0", display: "flex", alignItems: "center", justifyContent: "center", overflow: "hidden", background }, handStyle: hand && { width: HAND_IMG_WIDTH * handScale, height: HAND_IMG_HEIGHT * handScale, position: "absolute", pointerEvents: "none", backgroundImage: `url("${hand.imageUrl}")`, backgroundSize: "contain", backgroundRepeat: "no-repeat", left: -HAND_IMG_GAP_LEFT * handScale + handOffsetLeft, bottom: -HAND_IMG_GAP_BOTTOM * handScale + handOffsetBottom }, deviceStyle: { width: deviceWidth, height: deviceHeight, flexShrink: 0, position: "absolute", boxShadow: boxShadows.join(","), ...bezelStyle }, deviceImageStyle: appearance.type === "realistic" || appearance.type === "external-clay" ? { width: appearance.imageWidth, height: appearance.imageHeight, position: "absolute", pointerEvents: "none", overflow: "hidden", backgroundImage: `url("${appearance.imageUrl}")`, backgroundPosition: "top left", backgroundRepeat: "no-repeat", backgroundSize: `${appearance.imageWidth}px ${appearance.imageHeight}px`, // Rotate 90 degrees counter-clockwise around (0,0), then move the // result down into the viewport (rightmost transform is applied first). transformOrigin: "top left", transform: appearance.rotateImage ? `translateY(${appearance.imageWidth}px) rotate(-90deg)` : void 0 } : void 0, screenStyle: { width: screenWidth, height: screenHeight, maxHeight: screenMaxHeight, position: "absolute", top: screenOffsetTop, left: screenOffsetLeft, display: "flex", alignItems: "center", justifyContent: "center", overflow: "hidden", borderRadius: screenRadius, backgroundColor: overriddenColors.screenColor || screenColor, ...screenMaskImage && { maskImage: screenMaskImage, WebkitMaskImage: screenMaskImage, maskSize: "contain", WebkitMaskSize: "contain" } } }; } // ../../library/src/components/Device/DeviceCodeComponent.tsx import React20 from "react"; // ../../library/src/render/types/NewConstraints.tsx import React17 from "react"; // ../../library/src/render/utils/isFiniteNumber.ts function isFiniteNumber(value) { return typeof value === "number" && isFinite(value); } function finiteNumber(value) { return isFiniteNumber(value) ? value : void 0; } // ../../library/src/utils/type-guards.ts function isEmpty(obj) { return !obj || !Object.keys(obj).length && obj.constructor === Object; } function isReactElement(test) { return typeof test !== "string" && typeof test !== "number"; } function isReactChild(test) { return test !== null && typeof test !== "undefined" && typeof test !== "boolean" && !isEmpty(test); } // ../../library/src/render/types/Rect.ts var Rect; ((Rect2) => { function equals(rect, other) { if (rect === other) return true; if (!rect || !other) return false; return rect.x === other.x && rect.y === other.y && rect.width === other.width && rect.height === other.height; } Rect2.equals = equals; Rect2.atOrigin = (size2) => { return { ...size2, x: 0, y: 0 }; }; Rect2.fromTwoPoints = (a, b) => { return { x: Math.min(a.x, b.x), y: Math.min(a.y, b.y), width: Math.abs(a.x - b.x), height: Math.abs(a.y - b.y) }; }; Rect2.fromRect = (rect) => { return { x: rect.left, y: rect.top, width: rect.right - rect.left, height: rect.bottom - rect.top }; }; Rect2.multiply = (rect, n) => { return { x: rect.x * n, y: rect.y * n, width: rect.width * n, height: rect.height * n }; }; Rect2.divide = (rect, n) => { return (0, Rect2.multiply)(rect, 1 / n); }; Rect2.offset = (rect, delta) => { const xOffset = typeof delta.x === "number" ? delta.x : 0; const yOffset = typeof delta.y === "number" ? delta.y : 0; return { ...rect, x: rect.x + xOffset, y: rect.y + yOffset }; }; function inflate(rect, value) { if (value === 0) return rect; const doubleValue = 2 * value; return { x: rect.x - value, y: rect.y - value, width: rect.width + doubleValue, height: rect.height + doubleValue }; } Rect2.inflate = inflate; Rect2.pixelAligned = (rect) => { const x = Math.round(rect.x); const y = Math.round(rect.y); const rectMaxX = Math.round(rect.x + rect.width); const rectMaxY = Math.round(rect.y + rect.height); const width = Math.max(rectMaxX - x, 0); const height = Math.max(rectMaxY - y, 0); return { x, y, width, height }; }; Rect2.halfPixelAligned = (rect) => { const x = Math.round(rect.x * 2) / 2; const y = Math.round(rect.y * 2) / 2; const rectMaxX = Math.round((rect.x + rect.width) * 2) / 2; const rectMaxY = Math.round((rect.y + rect.height) * 2) / 2; const width = Math.max(rectMaxX - x, 1); const height = Math.max(rectMaxY - y, 1); return { x, y, width, height }; }; Rect2.round = (rect, decimals = 0) => { const x = roundedNumber(rect.x, decimals); const y = roundedNumber(rect.y, decimals); const width = roundedNumber(rect.width, decimals); const height = roundedNumber(rect.height, decimals); return { x, y, width, height }; }; Rect2.roundToOutside = (rect) => { const x = Math.floor(rect.x); const y = Math.floor(rect.y); const rectMaxX = Math.ceil(rect.x + rect.width); const rectMaxY = Math.ceil(rect.y + rect.height); const width = Math.max(rectMaxX - x, 0); const height = Math.max(rectMaxY - y, 0); return { x, y, width, height }; }; Rect2.minX = (rect) => { return rect.x; }; Rect2.maxX = (rect) => { return rect.x + rect.width; }; Rect2.minY = (rect) => { return rect.y; }; Rect2.maxY = (rect) => { return rect.y + rect.height; }; Rect2.positions = (rect) => { return { minX: rect.x, midX: rect.x + rect.width / 2, maxX: (0, Rect2.maxX)(rect), minY: rect.y, midY: rect.y + rect.height / 2, maxY: (0, Rect2.maxY)(rect) }; }; Rect2.center = (rect) => { return { x: rect.x + rect.width / 2, y: rect.y + rect.height / 2 }; }; Rect2.fromPoints = (ps) => { const xValues = ps.map((point) => point.x); const yValues = ps.map((point) => point.y); const x = Math.min(...xValues); const y = Math.min(...yValues); const width = Math.max(...xValues) - x; const height = Math.max(...yValues) - y; return { x, y, width, height }; }; Rect2.merge = (...rect) => { const min = { x: Math.min(...rect.map(Rect2.minX)), y: Math.min(...rect.map(Rect2.minY)) }; const max = { x: Math.max(...rect.map(Rect2.maxX)), y: Math.max(...rect.map(Rect2.maxY)) }; return (0, Rect2.fromTwoPoints)(min, max); }; Rect2.intersection = (rect1, rect2) => { const x = Math.max(rect1.x, rect2.x); const x2 = Math.min(rect1.x + rect1.width, rect2.x + rect2.width); const y = Math.max(rect1.y, rect2.y); const y2 = Math.min(rect1.y + rect1.height, rect2.y + rect2.height); return { x, y, width: x2 - x, height: y2 - y }; }; Rect2.points = (rect) => { return [ { x: (0, Rect2.minX)(rect), y: (0, Rect2.minY)(rect) }, { x: (0, Rect2.minX)(rect), y: (0, Rect2.maxY)(rect) }, { x: (0, Rect2.maxX)(rect), y: (0, Rect2.minY)(rect) }, { x: (0, Rect2.maxX)(rect), y: (0, Rect2.maxY)(rect) } ]; }; Rect2.transform = (rect, matrix) => { const { x: x1, y: y1 } = matrix.transformPoint({ x: rect.x, y: rect.y }); const { x: x2, y: y2 } = matrix.transformPoint({ x: rect.x + rect.width, y: rect.y }); const { x: x3, y: y3 } = matrix.transformPoint({ x: rect.x + rect.width, y: rect.y + rect.height }); const { x: x4, y: y4 } = matrix.transformPoint({ x: rect.x, y: rect.y + rect.height }); const x = Math.min(x1, x2, x3, x4); const width = Math.max(x1, x2, x3, x4) - x; const y = Math.min(y1, y2, y3, y4); const height = Math.max(y1, y2, y3, y4) - y; return { x, y, width, height }; }; Rect2.containsPoint = (rect, point) => { if (point.x < (0, Rect2.minX)(rect)) { return false; } if (point.x> (0, Rect2.maxX)(rect)) { return false; } if (point.y < (0, Rect2.minY)(rect)) { return false; } if (point.y> (0, Rect2.maxY)(rect)) { return false; } if (isNaN(rect.x)) { return false; } if (isNaN(rect.y)) { return false; } return true; }; Rect2.containsRect = (rectA, rectB) => { for (const point of (0, Rect2.points)(rectB)) { if (!(0, Rect2.containsPoint)(rectA, point)) { return false; } } return true; }; Rect2.toCSS = (rect) => { return { display: "block", transform: `translate(${rect.x}px, ${rect.y}px)`, width: `${rect.width}px`, height: `${rect.height}px` }; }; Rect2.inset = (rect, n) => { return { x: rect.x + n, y: rect.y + n, width: Math.max(0, rect.width - 2 * n), height: Math.max(0, rect.height - 2 * n) }; }; Rect2.intersects = (rectA, rectB) => { return !(rectB.x >= (0, Rect2.maxX)(rectA) || (0, Rect2.maxX)(rectB) <=r ectA.x || rectB.y>= (0, Rect2.maxY)(rectA) || (0, Rect2.maxY)(rectB) <=r ectA.y); }; Rect2.overlapHorizontally=( rectA, rectB)=> { const aMax = Rect2.maxX(rectA); const bMax = Rect2.maxX(rectB); return aMax > rectB.x && bMax > rectA.x; }; Rect2.overlapVertically = (rectA, rectB) => { const aMax = Rect2.maxY(rectA); const bMax = Rect2.maxY(rectB); return aMax > rectB.y && bMax > rectA.y; }; Rect2.doesNotIntersect = (rect, rects) => { return rects.find((comparingRect) => { return Rect2.intersects(comparingRect, rect); }) === void 0; }; Rect2.isEqual = (rectA, rectB) => { if (rectA && rectB) { const { x, y, width, height } = rectA; return rectB.x === x && rectB.y === y && rectB.width === width && rectB.height === height; } else { return rectA === rectB; } }; Rect2.cornerPoints = (rect) => { const rectMinX = rect.x; const rectMaxX = rect.x + rect.width; const rectMinY = rect.y; const rectMaxY = rect.y + rect.height; const corner1 = { x: rectMinX, y: rectMinY }; const corner2 = { x: rectMaxX, y: rectMinY }; const corner3 = { x: rectMaxX, y: rectMaxY }; const corner4 = { x: rectMinX, y: rectMaxY }; return [corner1, corner2, corner3, corner4]; }; Rect2.midPoints = (rect) => { const rectMinX = rect.x; const rectMidX = rect.x + rect.width / 2; const rectMaxX = rect.x + rect.width; const rectMinY = rect.y; const rectMidY = rect.y + rect.height / 2; const rectMaxY = rect.y + rect.height; const corner1 = { x: rectMidX, y: rectMinY }; const corner2 = { x: rectMaxX, y: rectMidY }; const corner3 = { x: rectMidX, y: rectMaxY }; const corner4 = { x: rectMinX, y: rectMidY }; return [corner1, corner2, corner3, corner4]; }; Rect2.pointDistance = (rect, point) => { let x = 0; let y = 0; if (point.x < rect.x) { x=r ect.x - point.x; } else if (point.x> Rect2.maxX(rect)) { x = point.x - Rect2.maxX(rect); } if (point.y < rect.y) { y=r ect.y - point.y; } else if (point.y> Rect2.maxY(rect)) { y = point.y - Rect2.maxY(rect); } return Point.distance({ x, y }, { x: 0, y: 0 }); }; const fromAnyDefaults = { x: 0, y: 0, width: 0, height: 0 }; Rect2.fromAny = (rect, defaults = fromAnyDefaults) => { return { x: rect.x || defaults.x, y: rect.y || defaults.y, width: rect.width || defaults.width, height: rect.height || defaults.height }; }; })(Rect || (Rect = {})); // ../../library/src/render/types/Constraints.ts var constraintDefaults = { left: null, right: null, top: null, bottom: null, centerX: "50%", centerY: "50%", aspectRatio: null, parentSize: null, width: 100, height: 100 }; var DimensionType = /* @__PURE__ */ ((DimensionType2) => { DimensionType2[DimensionType2["FixedNumber"] = 0] = "FixedNumber"; DimensionType2[DimensionType2["Percentage"] = 1] = "Percentage"; DimensionType2[DimensionType2["Auto"] = 2] = "Auto"; DimensionType2[DimensionType2["FractionOfFreeSpace"] = 3] = "FractionOfFreeSpace"; DimensionType2[DimensionType2["Viewport"] = 4] = "Viewport"; return DimensionType2; })(DimensionType || {}); function isConstraintSupportingChild(child) { if (!isReactChild(child) || !isReactElement(child)) { return false; } return true; } var ConstraintMask; ((ConstraintMask2) => { ConstraintMask2.quickfix = (constraints) => { if (constraints.widthType === 2 /* Auto */ || constraints.heightType === 2 /* Auto */) { constraints.aspectRatio = null; } if (isFiniteNumber(constraints.aspectRatio)) { if (constraints.left && constraints.right) { constraints.widthType = 0 /* FixedNumber */; } if (constraints.top && constraints.bottom) { constraints.heightType = 0 /* FixedNumber */; } if (constraints.left && constraints.right && constraints.top && constraints.bottom) { constraints.bottom = false; } if (constraints.widthType !== 0 /* FixedNumber */ && constraints.heightType !== 0 /* FixedNumber */) { constraints.heightType = 0 /* FixedNumber */; } } if (constraints.left && constraints.right) { if (constraints.fixedSize || constraints.widthType === 2 /* Auto */ || isFiniteNumber(constraints.maxWidth)) { constraints.right = false; } constraints.widthType = 0 /* FixedNumber */; } if (constraints.top && constraints.bottom) { if (constraints.fixedSize || constraints.heightType === 2 /* Auto */ || isFiniteNumber(constraints.maxHeight)) { constraints.bottom = false; } constraints.heightType = 0 /* FixedNumber */; } return constraints; }; })(ConstraintMask || (ConstraintMask = {})); function valueToDimensionType(value) { if (typeof value === "string") { const trimmedValue = value.trim(); if (trimmedValue === "auto") return 2 /* Auto */; if (trimmedValue.endsWith("fr")) return 3 /* FractionOfFreeSpace */; if (trimmedValue.endsWith("%")) return 1 /* Percentage */; if (trimmedValue.endsWith("vw") || trimmedValue.endsWith("vh")) return 4 /* Viewport */; } return 0 /* FixedNumber */; } var ConstraintValues; ((ConstraintValues2) => { ConstraintValues2.fromProperties = (props) => { const { left, right, top, bottom, width, height, centerX, centerY, aspectRatio, autoSize } = props; const constraints = ConstraintMask.quickfix({ left: isFiniteNumber(left) || isAnimatable(left), right: isFiniteNumber(right) || isAnimatable(right), top: isFiniteNumber(top) || isAnimatable(top), bottom: isFiniteNumber(bottom) || isAnimatable(bottom), widthType: valueToDimensionType(width), heightType: valueToDimensionType(height), aspectRatio: aspectRatio || null, fixedSize: autoSize === true }); let widthValue = null; let heightValue = null; let widthType = 0 /* FixedNumber */; let heightType = 0 /* FixedNumber */; if (constraints.widthType !== 0 /* FixedNumber */ && typeof width === "string") { const parsedWidth = parseFloat(width); if (width.endsWith("fr")) { widthType = 3 /* FractionOfFreeSpace */; widthValue = parsedWidth; } else if (width === "auto") { widthType = 2 /* Auto */; } else { widthType = 1 /* Percentage */; widthValue = parsedWidth / 100; } } else if (width !== void 0 && typeof width !== "string") { widthValue = Animatable.getNumber(width); } if (constraints.heightType !== 0 /* FixedNumber */ && typeof height === "string") { const parsedHeight = parseFloat(height); if (height.endsWith("fr")) { heightType = 3 /* FractionOfFreeSpace */; heightValue = parsedHeight; } else if (height === "auto") { heightType = 2 /* Auto */; } else { heightType = 1 /* Percentage */; heightValue = parseFloat(height) / 100; } } else if (height !== void 0 && typeof height !== "string") { heightValue = Animatable.getNumber(height); } let centerAnchorX = 0.5; let centerAnchorY = 0.5; if (centerX) { centerAnchorX = parseFloat(centerX) / 100; } if (centerY) { centerAnchorY = parseFloat(centerY) / 100; } return { left: constraints.left ? Animatable.getNumber(left) : null, right: constraints.right ? Animatable.getNumber(right) : null, top: constraints.top ? Animatable.getNumber(top) : null, bottom: constraints.bottom ? Animatable.getNumber(bottom) : null, widthType, heightType, width: widthValue, height: heightValue, aspectRatio: constraints.aspectRatio || null, centerAnchorX, centerAnchorY }; }; ConstraintValues2.toSize = (values, parentSizeInfo, autoSize, freeSpace) => { let width = null; let height = null; const parentWidth = (parentSizeInfo == null ? void 0 : parentSizeInfo.sizing) ? Animatable.getNumber(parentSizeInfo == null ? void 0 : parentSizeInfo.sizing.width) : null; const parentHeight = (parentSizeInfo == null ? void 0 : parentSizeInfo.sizing) ? Animatable.getNumber(parentSizeInfo == null ? void 0 : parentSizeInfo.sizing.height) : null; const hOpposingPinsOffset = pinnedOffset(values.left, values.right); if (parentWidth && isFiniteNumber(hOpposingPinsOffset)) { width = parentWidth - hOpposingPinsOffset; } else if (autoSize && values.widthType === 2 /* Auto */) { width = autoSize.width; } else if (isFiniteNumber(values.width)) { switch (values.widthType) { case 0 /* FixedNumber */: width = values.width; break; case 3 /* FractionOfFreeSpace */: width = freeSpace ? freeSpace.freeSpaceInParent.width / freeSpace.freeSpaceUnitDivisor.width * values.width : null; break; case 1 /* Percentage */: case 4 /* Viewport */: if (parentWidth) { width = parentWidth * values.width; } break; case 2 /* Auto */: break; default: assertNever(values.widthType); } } const vOpposingPinsOffset = pinnedOffset(values.top, values.bottom); if (parentHeight && isFiniteNumber(vOpposingPinsOffset)) { height = parentHeight - vOpposingPinsOffset; } else if (autoSize && values.heightType === 2 /* Auto */) { height = autoSize.height; } else if (isFiniteNumber(values.height)) { switch (values.heightType) { case 0 /* FixedNumber */: height = values.height; break; case 3 /* FractionOfFreeSpace */: height = freeSpace ? freeSpace.freeSpaceInParent.height / freeSpace.freeSpaceUnitDivisor.height * values.height : null; break; case 1 /* Percentage */: case 4 /* Viewport */: if (parentHeight) { height = parentHeight * values.height; } break; case 2 /* Auto */: break; default: assertNever(values.heightType); } } return sizeAfterApplyingConstraintsAndAspectRatio( width, height, values, { height: parentHeight != null ? parentHeight : 0, width: parentWidth != null ? parentWidth : 0 }, parentSizeInfo == null ? void 0 : parentSizeInfo.viewport ); }; ConstraintValues2.toRect = (values, parentSizeInfo = null, autoSize = null, pixelAlign = false, freeSpace = null) => { var _a; let x = values.left || 0; let y = values.top || 0; const { width, height } = ConstraintValues2.toSize(values, parentSizeInfo, autoSize, freeSpace); const parentSizeForPositioning = (_a = parentSizeInfo == null ? void 0 : parentSizeInfo.positioning) != null ? _a : null; const positioningParentWidth = parentSizeForPositioning ? Animatable.getNumber(parentSizeForPositioning.width) : null; const positioningParentHeight = parentSizeForPositioning ? Animatable.getNumber(parentSizeForPositioning.height) : null; if (values.left !== null) { x = values.left; } else if (positioningParentWidth && values.right !== null) { x = positioningParentWidth - values.right - width; } else if (positioningParentWidth) { x = values.centerAnchorX * positioningParentWidth - width / 2; } if (values.top !== null) { y = values.top; } else if (positioningParentHeight && values.bottom !== null) { y = positioningParentHeight - values.bottom - height; } else if (positioningParentHeight) { y = values.centerAnchorY * positioningParentHeight - height / 2; } const f = { x, y, width, height }; if (pixelAlign) { return Rect.pixelAligned(f); } return f; }; })(ConstraintValues || (ConstraintValues = {})); var defaultWidth = 200; var defaultHeight = 200; function getConstraintValue(constraint, value, parentSize, viewport) { if (typeof value === "string") { if (value.endsWith("%") && parentSize) { switch (constraint) { case "maxWidth": case "minWidth": return parseFloat(value) / 100 * parentSize.width; case "maxHeight": case "minHeight": return parseFloat(value) / 100 * parentSize.height; default: break; } } if (value.endsWith("vh") && viewport) { switch (constraint) { case "maxWidth": case "minWidth": return parseFloat(value) / 100 * viewport.width; case "maxHeight": case "minHeight": return parseFloat(value) / 100 * viewport.height; default: break; } } return parseFloat(value); } return value; } function constrainHeight(height, values, parentSize, viewport) { if (values.minHeight) { height = Math.max(getConstraintValue("minHeight", values.minHeight, parentSize, viewport), height); } if (values.maxHeight) { height = Math.min(getConstraintValue("maxHeight", values.maxHeight, parentSize, viewport), height); } return height; } function constrainWidth(width, values, parentSize, viewport) { if (values.minWidth) { width = Math.max(getConstraintValue("minWidth", values.minWidth, parentSize, viewport), width); } if (values.maxWidth) { width = Math.min(getConstraintValue("maxWidth", values.maxWidth, parentSize, viewport), width); } return width; } function sizeAfterApplyingConstraintsAndAspectRatio(width, height, values, parentSize, viewport) { let w = constrainWidth(isFiniteNumber(width) ? width : defaultWidth, values, parentSize, viewport); let h = constrainHeight(isFiniteNumber(height) ? height : defaultHeight, values, parentSize, viewport); if (isFiniteNumber(values.aspectRatio) && values.aspectRatio > 0) { if (isFiniteNumber(values.left) && isFiniteNumber(values.right)) { h = w / values.aspectRatio; } else if (isFiniteNumber(values.top) && isFiniteNumber(values.bottom)) { w = h * values.aspectRatio; } else if (values.widthType !== 0 /* FixedNumber */) { h = w / values.aspectRatio; } else { w = h * values.aspectRatio; } } return { width: w, height: h }; } function pinnedOffset(start, end) { if (!isFiniteNumber(start) || !isFiniteNumber(end)) return null; return start + end; } function getMergedConstraintsProps(props, constraints) { const result = {}; if (props.constraints) { result.constraints = { ...props.constraints, ...constraints }; } else { Object.assign(result, constraints); } return result; } // ../../library/src/render/types/NewConstraints.tsx function containsInvalidStringValues(props) { if (typeof props.right === "string") return true; if (typeof props.bottom === "string") return true; if (typeof props.left === "string" && (!props.center || props.center === "y")) { return true; } if (typeof props.top === "string" && (!props.center || props.center === "x")) { return true; } return false; } function constraintsEnabled(props) { if (!props._constraints) return false; if (containsInvalidStringValues(props)) return false; return props._constraints.enabled; } function sizeFromFiniteNumberProps(props) { const { size: size2 } = props; let { width, height } = props; if (isFiniteNumber(size2)) { if (width === void 0) { width = size2; } if (height === void 0) { height = size2; } } if (isFiniteNumber(width) && isFiniteNumber(height)) { return { width, height }; } return null; } function rectFromFiniteNumberProps(props) { const size2 = sizeFromFiniteNumberProps(props); if (size2 === null) { return null; } const { left, top } = props; if (isFiniteNumber(left) && isFiniteNumber(top)) { return { x: left, y: top, ...size2 }; } return null; } function calculateRect(props, parentSize, pixelAlign = true) { if (props.positionFixed || props.positionAbsolute) return null; const parentSizeDisabled = parentSize === 1 /* Disabled */ || parentSize === 2 /* DisabledForCurrentLevel */; if (!constraintsEnabled(props) || parentSizeDisabled) { return rectFromFiniteNumberProps(props); } const constraintValues = getConstraintValues(props); const enabledParentSize = deprecatedParentSize(parentSize); const parentSizeInfo = enabledParentSize ? { sizing: enabledParentSize, positioning: enabledParentSize, viewport: null } : null; return ConstraintValues.toRect(constraintValues, parentSizeInfo, null, pixelAlign, null); } function getConstraintValues(props) { const { left, right, top, bottom, center, _constraints, size: size2 } = props; let { width, height } = props; if (width === void 0) { width = size2; } if (height === void 0) { height = size2; } const { aspectRatio, autoSize } = _constraints; const constraintMask = ConstraintMask.quickfix({ left: isFiniteNumber(left), right: isFiniteNumber(right), top: isFiniteNumber(top), bottom: isFiniteNumber(bottom), widthType: valueToDimensionType(width), heightType: valueToDimensionType(height), aspectRatio: aspectRatio || null, fixedSize: autoSize === true }); let widthValue = null; let heightValue = null; let widthType = 0 /* FixedNumber */; let heightType = 0 /* FixedNumber */; if (constraintMask.widthType !== 0 /* FixedNumber */ && typeof width === "string") { const parsedWidth = parseFloat(width); if (width.endsWith("fr")) { widthType = 3 /* FractionOfFreeSpace */; widthValue = parsedWidth; } else if (width === "auto") { widthType = 2 /* Auto */; } else { widthType = 1 /* Percentage */; widthValue = parsedWidth / 100; } } else if (width !== void 0 && typeof width !== "string") { widthValue = width; } if (constraintMask.heightType !== 0 /* FixedNumber */ && typeof height === "string") { const parsedHeight = parseFloat(height); if (height.endsWith("fr")) { heightType = 3 /* FractionOfFreeSpace */; heightValue = parsedHeight; } else if (height === "auto") { heightType = 2 /* Auto */; } else { heightType = 1 /* Percentage */; heightValue = parseFloat(height) / 100; } } else if (height !== void 0 && typeof height !== "string") { heightValue = height; } let centerAnchorX = 0.5; let centerAnchorY = 0.5; if (center === true || center === "x") { constraintMask.left = false; if (typeof left === "string") { centerAnchorX = parseFloat(left) / 100; } } if (center === true || center === "y") { constraintMask.top = false; if (typeof top === "string") { centerAnchorY = parseFloat(top) / 100; } } return { // Because we check isFiniteNumber when creating the masks, // We know that left, right, top and bottom are numbers if the mask is true for the corresponding value // We need to cast this because typescript does not understand that left: constraintMask.left ? left : null, right: constraintMask.right ? right : null, top: constraintMask.top ? top : null, bottom: constraintMask.bottom ? bottom : null, widthType, heightType, width: widthValue, height: heightValue, aspectRatio: constraintMask.aspectRatio || null, centerAnchorX, centerAnchorY, minHeight: props.minHeight, maxHeight: props.maxHeight, minWidth: props.minWidth, maxWidth: props.maxWidth }; } var ParentSizeState = /* @__PURE__ */ ((ParentSizeState2) => { ParentSizeState2[ParentSizeState2["Unknown"] = 0] = "Unknown"; ParentSizeState2[ParentSizeState2["Disabled"] = 1] = "Disabled"; ParentSizeState2[ParentSizeState2["DisabledForCurrentLevel"] = 2] = "DisabledForCurrentLevel"; return ParentSizeState2; })(ParentSizeState || {}); var ConstraintsContext = React17.createContext({ parentSize: 0 /* Unknown */ }); function deprecatedParentSize(parentSize) { if (parentSize === 0 /* Unknown */ || parentSize === 1 /* Disabled */ || parentSize === 2 /* DisabledForCurrentLevel */) { return null; } return parentSize; } function useParentSize() { return React17.useContext(ConstraintsContext).parentSize; } function isSize(o) { return typeof o === "object"; } var ProvideParentSize = (props) => { const currentParentSize = useParentSize(); const { parentSize, children } = props; const value = React17.useMemo( () => ({ parentSize }), // We are generating the memoKeys in runtime and react doesn't like it, // but it should be safe to ignore. // eslint-disable-next-line react-hooks/exhaustive-deps [getParentWidth(parentSize), getParentHeight(parentSize)] ); if (currentParentSize === 1 /* Disabled */) { return children ? /* @__PURE__ */ React17.createElement(React17.Fragment, null, children) : null; } return /* @__PURE__ */ React17.createElement(ConstraintsContext.Provider, { value }, children); }; function getParentWidth(parentSize) { return isSize(parentSize) ? parentSize.width : parentSize; } function getParentHeight(parentSize) { return isSize(parentSize) ? parentSize.height : parentSize; } var ConsumeParentSize = ConstraintsContext.Consumer; function useProvideParentSize(node, parentSize) { return /* @__PURE__ */ React17.createElement(ProvideParentSize, { parentSize }, node); } function useConstraints(props) { const parentSize = useParentSize(); const calculatedRect = calculateRect(props, parentSize, true); return calculatedRect; } // ../../library/src/render/types/PropertyControls.ts var ControlType = /* @__PURE__ */ ((ControlType2) => { ControlType2["Boolean"] = "boolean"; ControlType2["Number"] = "number"; ControlType2["String"] = "string"; ControlType2["RichText"] = "richtext"; ControlType2["FusedNumber"] = "fusednumber"; ControlType2["Enum"] = "enum"; ControlType2["SegmentedEnum"] = "segmentedenum"; ControlType2["Color"] = "color"; ControlType2["Image"] = "image"; ControlType2["ResponsiveImage"] = "responsiveimage"; ControlType2["File"] = "file"; ControlType2["ComponentInstance"] = "componentinstance"; ControlType2["Array"] = "array"; ControlType2["EventHandler"] = "eventhandler"; ControlType2["Transition"] = "transition"; ControlType2["Link"] = "link"; ControlType2["Date"] = "date"; ControlType2["Object"] = "object"; ControlType2["Font"] = "font"; ControlType2["PageScope"] = "pagescope"; return ControlType2; })(ControlType || {}); // ../../library/src/modules/isFlexboxGapSupported.ts var isFlexboxGapSupportedCached; function isFlexboxGapSupported() { if (isFlexboxGapSupportedCached !== void 0) { return isFlexboxGapSupportedCached; } const flex = document.createElement("div"); Object.assign(flex.style, { position: "absolute", // avoid layout shift display: "flex", flexDirection: "column", rowGap: "1px" }); flex.appendChild(document.createElement("div")); flex.appendChild(document.createElement("div")); document.body.appendChild(flex); const isSupported = flex.scrollHeight === 1; if (flex.parentNode) { flex.parentNode.removeChild(flex); } isFlexboxGapSupportedCached = isSupported; return isSupported; } // ../../library/src/modules/workaroundFlexboxGapNotSupported.ts var flexboxGapNotSupportedClass = "flexbox-gap-not-supported"; var initialized = false; function installFlexboxGapWorkaroundIfNeeded() { if (initialized) return; initialized = true; if (isFlexboxGapSupported()) return; document.body.classList.add(flexboxGapNotSupportedClass); } // ../../library/src/render/utils/injectDeprecatedRichTextRules.ts var richTextStylesRule = ` [data-framer-component-type="DeprecatedRichText"] p, [data-framer-component-type="DeprecatedRichText"] div, [data-framer-component-type="DeprecatedRichText"] h1, [data-framer-component-type="DeprecatedRichText"] h2, [data-framer-component-type="DeprecatedRichText"] h3, [data-framer-component-type="DeprecatedRichText"] h4, [data-framer-component-type="DeprecatedRichText"] h5, [data-framer-component-type="DeprecatedRichText"] h6, [data-framer-component-type="DeprecatedRichText"] li, [data-framer-component-type="DeprecatedRichText"] ol, [data-framer-component-type="DeprecatedRichText"] ul, [data-framer-component-type="DeprecatedRichText"] span:not([data-text-fill]) { font-family: var(--framer-font-family, Inter, Inter Placeholder, sans-serif); font-style: var(--framer-font-style, normal); font-weight: var(--framer-font-weight, 400); color: var(--framer-text-color, #000); font-size: var(--framer-font-size, 16px); letter-spacing: var(--framer-letter-spacing, 0); text-transform: var(--framer-text-transform, none); text-decoration: var(--framer-text-decoration, none); line-height: var(--framer-line-height, 1.2em); text-align: var(--framer-text-alignment, start); } `; var richTextParagraphSpacingStylesRule = ` [data-framer-component-type="DeprecatedRichText"] p:not(:first-child), [data-framer-component-type="DeprecatedRichText"] div:not(:first-child), [data-framer-component-type="DeprecatedRichText"] h1:not(:first-child), [data-framer-component-type="DeprecatedRichText"] h2:not(:first-child), [data-framer-component-type="DeprecatedRichText"] h3:not(:first-child), [data-framer-component-type="DeprecatedRichText"] h4:not(:first-child), [data-framer-component-type="DeprecatedRichText"] h5:not(:first-child), [data-framer-component-type="DeprecatedRichText"] h6:not(:first-child), [data-framer-component-type="DeprecatedRichText"] ol:not(:first-child), [data-framer-component-type="DeprecatedRichText"] ul:not(:first-child), [data-framer-component-type="DeprecatedRichText"] .framer-image:not(:first-child) { margin-top: var(--framer-paragraph-spacing, 0); } `; var richTextBackgroundMaskStylesRule = ` [data-framer-component-type="DeprecatedRichText"] span[data-text-fill] { display: inline-block; background-clip: text; -webkit-background-clip: text; -webkit-text-fill-color: transparent; } `; var richTextLinkStylesRule = ` [data-framer-component-type="DeprecatedRichText"] a, [data-framer-component-type="DeprecatedRichText"] a span:not([data-text-fill]) { font-family: var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif)); font-style: var(--framer-link-font-style, var(--framer-font-style, normal)); font-weight: var(--framer-link-font-weight, var(--framer-font-weight, 400)); color: var(--framer-link-text-color, var(--framer-text-color, #000)); font-size: var(--framer-link-font-size, var(--framer-font-size, 16px)); text-transform: var(--framer-link-text-transform, var(--framer-text-transform, none)); text-decoration: var(--framer-link-text-decoration, var(--framer-text-decoration, none)); } `; var richTextLinkHoverStylesRule = ` [data-framer-component-type="DeprecatedRichText"] a:hover, [data-framer-component-type="DeprecatedRichText"] a:hover span:not([data-text-fill]) { font-family: var(--framer-link-hover-font-family, var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif))); font-style: var(--framer-link-hover-font-style, var(--framer-link-font-style, var(--framer-font-style, normal))); font-weight: var(--framer-link-hover-font-weight, var(--framer-link-font-weight, var(--framer-font-weight, 400))); color: var(--framer-link-hover-text-color, var(--framer-link-text-color, var(--framer-text-color, #000))); font-size: var(--framer-link-hover-font-size, var(--framer-link-font-size, var(--framer-font-size, 16px))); text-transform: var(--framer-link-hover-text-transform, var(--framer-link-text-transform, var(--framer-text-transform, none))); text-decoration: var(--framer-link-hover-text-decoration, var(--framer-link-text-decoration, var(--framer-text-decoration, none))); } `; var richTextLinkCurrentStylesRule = ` a[data-framer-page-link-current], a[data-framer-page-link-current] span:not([data-text-fill]) { font-family: var(--framer-link-current-font-family, var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif))); font-style: var(--framer-link-current-font-style, var(--framer-link-font-style, var(--framer-font-style, normal))); font-weight: var(--framer-link-current-font-weight, var(--framer-link-font-weight, var(--framer-font-weight, 400))); color: var(--framer-link-current-text-color, var(--framer-link-text-color, var(--framer-text-color, #000))); font-size: var(--framer-link-current-font-size, var(--framer-link-font-size, var(--framer-font-size, 16px))); text-transform: var(--framer-link-current-text-transform, var(--framer-link-text-transform, var(--framer-text-transform, none))); text-decoration: var(--framer-link-current-text-decoration, var(--framer-link-text-decoration, var(--framer-text-decoration, none))); } `; var richTextLinkCurrentHoverStylesRule = ` a[data-framer-page-link-current]:hover, a[data-framer-page-link-current]:hover span:not([data-text-fill]) { font-family: var(--framer-link-hover-font-family, var(--framer-link-current-font-family, var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif)))); font-style: var(--framer-link-hover-font-style, var(--framer-link-current-font-style, var(--framer-link-font-style, var(--framer-font-style, normal)))); font-weight: var(--framer-link-hover-font-weight, var(--framer-link-current-font-weight, var(--framer-link-font-weight, var(--framer-font-weight, 400)))); color: var(--framer-link-hover-text-color, var(--framer-link-current-text-color, var(--framer-link-text-color, var(--framer-text-color, #000)))); font-size: var(--framer-link-hover-font-size, var(--framer-link-current-font-size, var(--framer-link-font-size, var(--framer-font-size, 16px)))); text-transform: var(--framer-link-hover-text-transform, var(--framer-link-current-text-transform, var(--framer-link-text-transform, var(--framer-text-transform, none)))); text-decoration: var(--framer-link-hover-text-decoration, var(--framer-link-current-text-decoration, var(--framer-link-text-decoration, var(--framer-text-decoration, none)))); } `; var richTextBoldStylesRule = ` [data-framer-component-type="DeprecatedRichText"] strong { font-weight: bolder; } `; var richTextItalicStylesRule = ` [data-framer-component-type="DeprecatedRichText"] em { font-style: italic; } `; var richTextImageRule = ` [data-framer-component-type="DeprecatedRichText"] .framer-image { display: block; max-width: 100%; height: auto; } `; var richTextBlockElementResetRule = ` [data-framer-component-type="DeprecatedRichText"] p, [data-framer-component-type="DeprecatedRichText"] div, [data-framer-component-type="DeprecatedRichText"] h1, [data-framer-component-type="DeprecatedRichText"] h2, [data-framer-component-type="DeprecatedRichText"] h3, [data-framer-component-type="DeprecatedRichText"] h4, [data-framer-component-type="DeprecatedRichText"] h5, [data-framer-component-type="DeprecatedRichText"] h6 { margin: 0; padding: 0; } `; var richTextStylesPresetResetRule = ` [data-framer-component-type="DeprecatedRichText"] .text-styles-preset-reset { --framer-font-family: Inter, Inter Placeholder, sans-serif; --framer-font-style: normal; --framer-font-weight: 500; --framer-text-color: #000; --framer-font-size: 16px; --framer-letter-spacing: 0; --framer-text-transform: none; --framer-text-decoration: none; --framer-line-height: 1.2em; --framer-text-alignment: start; } `; var richTextStylesList = ` [data-framer-component-type="DeprecatedRichText"] ul, [data-framer-component-type="DeprecatedRichText"] ol { display: table; width: 100%; padding-left: 0; margin: 0; } `; var richTextStylesListItem = ` [data-framer-component-type="DeprecatedRichText"] li { display: table-row; counter-increment: list-item; list-style: none; } `; var richTextStylesNumberedListMarker = ` [data-framer-component-type="DeprecatedRichText"] ol > li::before { display: table-cell; width: 2.25ch; box-sizing: border-box; padding-right: 0.75ch; content: counter(list-item) "."; white-space: nowrap; } `; var richTextStylesBulletedListMarker = ` [data-framer-component-type="DeprecatedRichText"] ul > li::before { display: table-cell; width: 2.25ch; box-sizing: border-box; padding-right: 0.75ch; content: "\u2022"; } `; var deprecatedRichTextCSSRules = [ `[data-framer-component-type="DeprecatedRichText"] { cursor: inherit; }`, richTextStylesPresetResetRule, richTextBlockElementResetRule, richTextStylesRule, richTextParagraphSpacingStylesRule, richTextBackgroundMaskStylesRule, richTextLinkStylesRule, richTextLinkHoverStylesRule, richTextLinkCurrentStylesRule, richTextLinkCurrentHoverStylesRule, richTextBoldStylesRule, richTextItalicStylesRule, richTextImageRule, richTextStylesList, richTextStylesListItem, richTextStylesNumberedListMarker, richTextStylesBulletedListMarker ]; // ../../library/src/render/utils/injectRichTextRules.ts var richTextCSSRules = [ /* css */ ` p.framer-text, div.framer-text, h1.framer-text, h2.framer-text, h3.framer-text, h4.framer-text, h5.framer-text, h6.framer-text, ol.framer-text, ul.framer-text { margin: 0; padding: 0; } `, /* css */ ` p.framer-text, div.framer-text, h1.framer-text, h2.framer-text, h3.framer-text, h4.framer-text, h5.framer-text, h6.framer-text, li.framer-text, ol.framer-text, ul.framer-text, span.framer-text:not([data-text-fill]) { font-family: var(--framer-font-family, Inter, Inter Placeholder, sans-serif); font-style: var(--framer-font-style, normal); font-weight: var(--framer-font-weight, 400); color: var(--framer-text-color, #000); font-size: var(--framer-font-size, 16px); letter-spacing: var(--framer-letter-spacing, 0); text-transform: var(--framer-text-transform, none); text-decoration: var(--framer-text-decoration, none); line-height: var(--framer-line-height, 1.2em); text-align: var(--framer-text-alignment, start); } `, /* css */ ` strong.framer-text { font-weight: bolder; } `, /* css */ ` em.framer-text { font-style: italic; } `, /* css */ ` code.framer-text { padding: 2px; border-radius: 4px; background-color: rgba(0, 0, 0, .08); } `, /* css */ ` code.framer-text, code.framer-text .framer-text:not([data-text-fill]) { font-family: "Courier New", monospace; } `, /* css */ ` p.framer-text:not(:first-child), div.framer-text:not(:first-child), h1.framer-text:not(:first-child), h2.framer-text:not(:first-child), h3.framer-text:not(:first-child), h4.framer-text:not(:first-child), h5.framer-text:not(:first-child), h6.framer-text:not(:first-child), ol.framer-text:not(:first-child), ul.framer-text:not(:first-child), .framer-image.framer-text:not(:first-child) { margin-top: var(--framer-paragraph-spacing, 0); } `, // The first child of a list item is a paragraph. If the second child is a // nested list we don't want it to have paragraph spacing. /* css */ ` li.framer-text > ul.framer-text:nth-child(2), li.framer-text > ol.framer-text:nth-child(2) { margin-top: 0; } `, // background-clip: text clips to the physical dimensions of text as appose // to the rendered dimensions. normal text will bleed out side these // constraints but since this is just a clipping mask over the area the text // takes up we have cases where the text will get clipped. That is why we // need to expand the area that the gradient applies to to allow users to // use low line-heights. This will result in gradients not aligning // perfectly to the edges of the text. but this is a acceptable trade off at // this point. For now we increase the area of the clipping mask on the // bottom (for descenders) and the right for italic or wide fonts. /* css */ ` .framer-text[data-text-fill] { display: inline-block; background-clip: text; -webkit-background-clip: text; /* make this a transparent color if you want to visualise the clipping */ -webkit-text-fill-color: transparent; padding: max(0em, calc(calc(1.3em - var(--framer-line-height, 1.3em)) / 2)); margin: min(0em, calc(calc(1.3em - var(--framer-line-height, 1.3em)) / -2)); } `, /* Cursor inherit to overwrite the user agent stylesheet on rich text links */ /* css */ ` a.framer-text, a.framer-text span.framer-text:not([data-text-fill]) { font-family: var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif)); font-style: var(--framer-link-font-style, var(--framer-font-style, normal)); font-weight: var(--framer-link-font-weight, var(--framer-font-weight, 400)); color: var(--framer-link-text-color, var(--framer-text-color, #000)); font-size: var(--framer-link-font-size, var(--framer-font-size, 16px)); text-transform: var(--framer-link-text-transform, var(--framer-text-transform, none)); text-decoration: var(--framer-link-text-decoration, var(--framer-text-decoration, none)); cursor: var(--framer-custom-cursors, pointer); } `, /* css */ ` a.framer-text:hover, a.framer-text:hover span.framer-text:not([data-text-fill]) { font-family: var(--framer-link-hover-font-family, var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif))); font-style: var(--framer-link-hover-font-style, var(--framer-link-font-style, var(--framer-font-style, normal))); font-weight: var(--framer-link-hover-font-weight, var(--framer-link-font-weight, var(--framer-font-weight, 400))); color: var(--framer-link-hover-text-color, var(--framer-link-text-color, var(--framer-text-color, #000))); font-size: var(--framer-link-hover-font-size, var(--framer-link-font-size, var(--framer-font-size, 16px))); text-transform: var(--framer-link-hover-text-transform, var(--framer-link-text-transform, var(--framer-text-transform, none))); text-decoration: var(--framer-link-hover-text-decoration, var(--framer-link-text-decoration, var(--framer-text-decoration, none))); } `, /* css */ ` a.framer-text[data-framer-page-link-current], a.framer-text[data-framer-page-link-current] span.framer-text:not([data-text-fill]) { font-family: var(--framer-link-current-font-family, var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif))); font-style: var(--framer-link-current-font-style, var(--framer-link-font-style, var(--framer-font-style, normal))); font-weight: var(--framer-link-current-font-weight, var(--framer-link-font-weight, var(--framer-font-weight, 400))); color: var(--framer-link-current-text-color, var(--framer-link-text-color, var(--framer-text-color, #000))); font-size: var(--framer-link-current-font-size, var(--framer-link-font-size, var(--framer-font-size, 16px))); text-transform: var(--framer-link-current-text-transform, var(--framer-link-text-transform, var(--framer-text-transform, none))); text-decoration: var(--framer-link-current-text-decoration, var(--framer-link-text-decoration, var(--framer-text-decoration, none))); } `, /* css */ ` a.framer-text[data-framer-page-link-current]:hover, a.framer-text[data-framer-page-link-current]:hover span.framer-text:not([data-text-fill]) { font-family: var(--framer-link-hover-font-family, var(--framer-link-current-font-family, var(--framer-link-font-family, var(--framer-font-family, Inter, Inter Placeholder, sans-serif)))); font-style: var(--framer-link-hover-font-style, var(--framer-link-current-font-style, var(--framer-link-font-style, var(--framer-font-style, normal)))); font-weight: var(--framer-link-hover-font-weight, var(--framer-link-current-font-weight, var(--framer-link-font-weight, var(--framer-font-weight, 400)))); color: var(--framer-link-hover-text-color, var(--framer-link-current-text-color, var(--framer-link-text-color, var(--framer-text-color, #000)))); font-size: var(--framer-link-hover-font-size, var(--framer-link-current-font-size, var(--framer-link-font-size, var(--framer-font-size, 16px)))); text-transform: var(--framer-link-hover-text-transform, var(--framer-link-current-text-transform, var(--framer-link-text-transform, var(--framer-text-transform, none)))); text-decoration: var(--framer-link-hover-text-decoration, var(--framer-link-current-text-decoration, var(--framer-link-text-decoration, var(--framer-text-decoration, none)))); } `, /* css */ ` .framer-image.framer-text { display: block; max-width: 100%; height: auto; } `, /* css */ ` .text-styles-preset-reset.framer-text { --framer-font-family: Inter, Inter Placeholder, sans-serif; --framer-font-style: normal; --framer-font-weight: 500; --framer-text-color: #000; --framer-font-size: 16px; --framer-letter-spacing: 0; --framer-text-transform: none; --framer-text-decoration: none; --framer-line-height: 1.2em; --framer-text-alignment: start; } `, /* css */ ` ul.framer-text, ol.framer-text { display: table; width: 100%; } `, /* css */ ` li.framer-text { display: table-row; counter-increment: list-item; list-style: none; } `, /* css */ ` ol.framer-text > li.framer-text::before { display: table-cell; width: 2.25ch; box-sizing: border-box; padding-right: 0.75ch; content: counter(list-item) "."; white-space: nowrap; } `, /* css */ ` ul.framer-text > li.framer-text::before { display: table-cell; width: 2.25ch; box-sizing: border-box; padding-right: 0.75ch; content: "\u2022"; } `, /* css */ ` .framer-text-module[style*="aspect-ratio"] > :first-child { width: 100%; } `, /* css */ ` @supports not (aspect-ratio: 1) { .framer-text-module[style*="aspect-ratio"] { position: relative; } } `, /* css */ ` @supports not (aspect-ratio: 1) { .framer-text-module[style*="aspect-ratio"]::before { content: ""; display: block; padding-bottom: calc(100% / calc(var(--aspect-ratio))); } } `, /* css */ ` @supports not (aspect-ratio: 1) { .framer-text-module[style*="aspect-ratio"] > :first-child { position: absolute; top: 0; left: 0; height: 100%; } } ` ]; // ../../library/src/render/utils/setDocumentStyles.ts var defaultCache = /* @__PURE__ */ new Set(); var defaultSheet; function injectCSSRule(cssRule, sheet, cache3 = defaultCache) { if (!cssRule || cache3.has(cssRule) || typeof document === "undefined") return; cache3.add(cssRule); if (!sheet) { if (!defaultSheet) { const styleElement = document.createElement("style"); styleElement.setAttribute("type", "text/css"); styleElement.setAttribute("data-framer-css", "true"); if (!document.head) { console.warn("not injecting CSS: the document is missing a
element"); return; } document.head.appendChild(styleElement); if (styleElement.sheet) { defaultSheet = styleElement.sheet; } else { console.warn("not injecting CSS: injected